a0"; position: absolute; transition: border-bottom-color 200ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; border-bottom: 1px solid rgba(0, 0, 0, 0.42); pointer-events: none; } .MuiInput-underline:hover:not(.Mui-disabled):before { border-bottom: 2px solid #000000; } .MuiInput-underline.Mui-disabled:before { border-bottom-style: dotted; } @media (hover: none) { .MuiInput-underline:hover:not(.Mui-disabled):before { border-bottom: 1px solid rgba(0, 0, 0, 0.42); } } .MuiPopover-paper { outline: 0; position: absolute; max-width: calc(100% - 32px); min-width: 16px; max-height: calc(100% - 32px); min-height: 16px; overflow-x: hidden; overflow-y: auto; } .MuiMenu-paper { max-height: calc(100% - 96px); -webkit-overflow-scrolling: touch; } .MuiMenu-list { outline: 0; } .MuiSelect-select { cursor: pointer; min-width: 16px; user-select: none; border-radius: 0; -moz-appearance: none; -webkit-appearance: none; } .MuiSelect-select:focus { border-radius: 0; background-color: rgba(0, 0, 0, 0.05); } .MuiSelect-select::-ms-expand { display: none; } .MuiSelect-select.Mui-disabled { cursor: default; } .MuiSelect-select[multiple] { height: auto; } .MuiSelect-select:not([multiple]) option, .MuiSelect-select:not([multiple]) optgroup { background-color: #fff; } .MuiSelect-select.MuiSelect-select { padding-right: 24px; } .MuiSelect-filled.MuiSelect-filled { padding-right: 32px; } .MuiSelect-outlined { border-radius: 5px; } .MuiSelect-outlined.MuiSelect-outlined { padding-right: 32px; } .MuiSelect-selectMenu { height: auto; overflow: hidden; min-height: 1.1876em; white-space: nowrap; text-overflow: ellipsis; } .MuiSelect-icon { top: calc(50% - 12px); color: rgba(0, 0, 0, 0.54); right: 0; position: absolute; pointer-events: none; } .MuiSelect-icon.Mui-disabled { color: #000000; } .MuiSelect-iconOpen { transform: rotate(180deg); } .MuiSelect-iconFilled { right: 7px; } .MuiSelect-iconOutlined { right: 7px; } .MuiSelect-nativeInput { left: 0; width: 100%; bottom: 0; opacity: 0; position: absolute; pointer-events: none; } .jss88 { border: none; font-size: 1rem; box-shadow: inset 0 0 0 1px #949494; box-sizing: border-box; min-height: 48px; transition: all .3s; line-height: 40px; border-radius: 5px; background-color: #fff; } @media (min-width:600px) { .jss88 { min-height: 40px; line-height: 32px; } } .jss88.jss88 { padding: 4px 32px 4px 12px; } .jss88:hover:not(.jss96) { box-shadow: inset 0 0 0 1px #0f69af; } .jss88:focus { box-shadow: inset 0 0 0 1px #0f69af, 0 0 6px 0 rgba(15, 105, 175, 0.5); border-radius: 5px; background-color: #fff; } .jss88.jss95 { box-shadow: inset 0 0 0 2px #ce0000; } .jss88.jss95:hover { box-shadow: inset 0 0 0 2px #ce0000; } .jss88.jss95:focus { box-shadow: inset 0 0 0 2px #ce0000; } .jss89 { border: 1px solid #f3f3f7; background-color: #f3f3f7; } .jss89:focus { background-color: #f3f3f7; } .jss90 { top: 21px; color: #0f69af; right: 16px; height: 6px; font-size: 0.625rem; } @media (min-width:600px) { .jss90 { top: 17px; } } @media (min-width:600px) { .jss91 { top: 13px; right: 12px; font-size: 0.5625rem; } } .jss92 { color: rgba(0, 0, 0, 0.38); } @media (min-width:600px) { .jss93 { font-size: 0.875rem; min-height: 32px; line-height: 23px; } .jss93.jss88 { padding: 4px 28px 4px 12px; } } .jss94 { font-size: 0.875rem; min-height: 48px; line-height: 38px; } @media (min-width:600px) { .jss94 { line-height: 40px; } } .jss94 ~ svg { top: 21px; } .jss96 { color: #000; border-color: #e4e4e4; background-color: #e4e4e4; } .jss98 .MuiMenuItem-root { white-space: break-spaces; } .jss99 { padding: 4px 0px; } .jss99 .MuiMenuItem-root { padding: 4px 12px; font-size: 0.875rem; } .jss100 { border: 1px solid #949494; margin-top: 4px; border-radius: 5px; } .jss135 { border: 1px solid #949494; margin-top: 4px; border-radius: 5px; } .MuiButton-root { color: #000000; padding: 6px 16px; font-size: 0.875rem; min-width: 144px; box-sizing: border-box; transition: background-color 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms,box-shadow 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms,border 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.75; padding-left: 24px; border-radius: 5px; padding-right: 24px; text-transform: none; } .MuiButton-root:hover { text-decoration: none; background-color: rgba(0, 0, 0, 0.04); } .MuiButton-root.Mui-disabled { color: #000000; } @media (hover: none) { .MuiButton-root:hover { background-color: transparent; } } .MuiButton-root:hover.Mui-disabled { background-color: transparent; } .MuiButton-label { width: 100%; display: inherit; align-items: inherit; justify-content: inherit; } .MuiButton-text { color: #0f69af; padding: 6px 8px; } .MuiButton-text:hover { color: #003f71; background-color: transparent; } .MuiButton-textPrimary { color: #0f69af; } .MuiButton-textPrimary:hover { background-color: transparent; } @media (hover: none) { .MuiButton-textPrimary:hover { background-color: transparent; } } .MuiButton-textSecondary { color: #503191; } .MuiButton-textSecondary:hover { color: #210953; background-color: transparent; } @media (hover: none) { .MuiButton-textSecondary:hover { background-color: transparent; } } .MuiButton-outlined { border: 1px solid rgba(0, 0, 0, 0.23); padding: 5px 15px; } .MuiButton-outlined.Mui-disabled { color: #949494; border: 1px solid #c9c9c9; border-color: #949494; } .MuiButton-outlinedPrimary { color: #0f69af; border: 1px solid rgba(15, 105, 175, 0.5); } .MuiButton-outlinedPrimary:hover { color: #003f71; border: 1px solid #0f69af; border-color: #003f71; background-color: transparent; } .MuiButton-outlinedPrimary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(15, 105, 175, 0.5), inset 0 0 0 1px #0f69af; border-color: #0f69af; } @media (hover: none) { .MuiButton-outlinedPrimary:hover { background-color: transparent; } } .MuiButton-outlinedSecondary { color: #503191; border: 1px solid rgba(80, 49, 145, 0.5); } .MuiButton-outlinedSecondary:hover { color: #210953; border: 1px solid #503191; border-color: #210953; background-color: transparent; } .MuiButton-outlinedSecondary.Mui-disabled { border: 1px solid #000000; } .MuiButton-outlinedSecondary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(80, 49, 145, 0.5), inset 0 0 0 1px #503191; border-color: #503191; } @media (hover: none) { .MuiButton-outlinedSecondary:hover { background-color: transparent; } } .MuiButton-contained { color: rgba(0, 0, 0, 0.87); box-shadow: none; background-color: #e4e4e4; } .MuiButton-contained:hover { color: #ffffff; box-shadow: none; background-color: #d5d5d5; } .MuiButton-contained.Mui-focusVisible { box-shadow: none; } .MuiButton-contained:active { box-shadow: none; } .MuiButton-contained.Mui-disabled { color: #ffffff; box-shadow: none; background-color: #949494; } @media (hover: none) { .MuiButton-contained:hover { box-shadow: 0px 1px 5px 0px rgba(0,0,0,0.0),0px 2px 2px 0px rgba(0,0,0,0.14),0px 3px 1px -2px rgba(0,0,0,0.12); background-color: #e4e4e4; } } .MuiButton-contained:hover.Mui-disabled { background-color: #c9c9c9; } .MuiButton-containedPrimary { color: #fff; background-color: #0f69af; } .MuiButton-containedPrimary:hover { background-color: #003f71; } .MuiButton-containedPrimary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(15, 105, 175, 0.5), inset 0 0 0 2px #ffffff; } @media (hover: none) { .MuiButton-containedPrimary:hover { background-color: #0f69af; } } .MuiButton-containedSecondary { color: #ffffff; background-color: #503191; } .MuiButton-containedSecondary:hover { background-color: #210953; } .MuiButton-containedSecondary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(80, 49, 145, 0.5), inset 0 0 0 2px #ffffff; } @media (hover: none) { .MuiButton-containedSecondary:hover { background-color: #503191; } } .MuiButton-disableElevation { box-shadow: none; } .MuiButton-disableElevation:hover { box-shadow: none; } .MuiButton-disableElevation.Mui-focusVisible { box-shadow: none; } .MuiButton-disableElevation:active { box-shadow: none; } .MuiButton-disableElevation.Mui-disabled { box-shadow: none; } .MuiButton-colorInherit { color: inherit; border-color: currentColor; } .MuiButton-textSizeSmall { padding: 4px 5px; font-size: 0.8125rem; } .MuiButton-textSizeLarge { padding: 8px 11px; font-size: 0.9375rem; } .MuiButton-outlinedSizeSmall { padding: 3px 9px; font-size: 0.8125rem; } .MuiButton-outlinedSizeLarge { padding: 7px 21px; font-size: 0.9375rem; } .MuiButton-containedSizeSmall { padding: 4px 10px; font-size: 0.8125rem; } .MuiButton-containedSizeLarge { padding: 8px 22px; font-size: 0.9375rem; } .MuiButton-sizeLarge { padding: 10px 24px; font-size: 1rem; } @media (min-width:600px) { .MuiButton-sizeLarge { padding: 6px 24px; } } .MuiButton-sizeLarge.MuiButton-outlinedSizeLarge { padding: 9px 24px; } @media (min-width:600px) { .MuiButton-sizeLarge.MuiButton-outlinedSizeLarge { padding: 5px 24px; } } .MuiButton-fullWidth { width: 100%; } .MuiButton-startIcon { display: inherit; margin-left: -4px; margin-right: 8px; } .MuiButton-startIcon.MuiButton-iconSizeSmall { margin-left: -2px; } .MuiButton-endIcon { display: inherit; margin-left: 8px; margin-right: -4px; } .MuiButton-endIcon.MuiButton-iconSizeSmall { margin-right: -2px; } .MuiButton-iconSizeSmall > *:first-child { font-size: 18px; } .MuiButton-iconSizeMedium > *:first-child { font-size: 20px; } .MuiButton-iconSizeLarge > *:first-child { font-size: 22px; } .jss77 { border: none; height: 36px; display: flex; padding: 0px 16px; border-radius: 5px; } @media (min-width:960px) { .jss77 { border: 1px solid #949494; height: 40px; padding: 0; } } .jss78 { width: 100%; border: 1px solid #949494; padding-left: 12px; border-radius: 5px; } @media (min-width:960px) { .jss78 { border: none; } } .jss79 { order: 2; padding: 4px 0 7px; } .jss79::placeholder { color: #949494; opacity: 1; font-size: 0.875rem; } @media (min-width:960px) { .jss79::placeholder { color: unset; opacity: 0.75 !important; font-size: 0.875rem; } } .jss79:focus::placeholder { color: transparent; } .jss80 { color: #503191; order: 4; width: 32px; height: 70%; border-left: 1px solid #c9c9c9; flex-shrink: 0; margin-left: 12px; } @media (min-width:960px) { .jss80 { color: #fff; right: -1px; width: 56px; border: 1px solid #503191; height: 100%; font-size: 1.125rem; box-sizing: content-box; background-color: #503191; border-top-right-radius: 4px; border-bottom-right-radius: 4px; } } .jss81 { order: 1; height: 100%; display: flex; margin-right: 12px; } @media (min-width:960px) { .jss81 { display: none; } } .jss82 { display: none; } .jss83 { order: 4; display: inline-flex; margin-left: 12px; } .jss84 { order: 3; flex-shrink: 0; margin-left: 12px; } .jss85 { order: 3; height: 100%; display: none; font-size: 0.625rem; margin-left: 12px; } .jss86 { display: inline-flex; } .jss87 { display: none; } .jss87 .MuiSelect-root { height: 38px; padding: 4px 36px 4px 12px; position: relative; box-shadow: none; line-height: 30px; } .jss87 .MuiSvgIcon-root { top: 16px; } @media (min-width:960px) { .jss87 { display: block; } } .jss87 .MuiSelect-root:after { right: 0; width: 1px; bottom: 7px; height: 24px; content: ''; display: block; position: absolute; background: #949494; } .jss87 .MuiSelect-root:hover { box-shadow: none; } .jss87 .MuiSelect-root:focus-visible { outline: revert; } .MuiTypography-root { margin: 0; } .MuiTypography-body2 { color: #000000; font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.43; } .MuiTypography-body1 { color: #000000; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.5; } .MuiTypography-caption { color: #000000; font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 0.9375; } .MuiTypography-button { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.75; text-transform: uppercase; } .MuiTypography-h1 { color: #000000; font-size: 1.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 0.42px; } .MuiTypography-h2 { color: #000000; font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 1.5px; text-transform: uppercase; } .MuiTypography-h3 { color: #000000; font-size: 1.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; } .MuiTypography-h4 { color: #000000; font-size: 2.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.235; } .MuiTypography-h5 { font-size: 1.5rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.334; } .MuiTypography-h6 { font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.6; } .MuiTypography-subtitle1 { font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.75; } .MuiTypography-subtitle2 { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.57; } .MuiTypography-overline { font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 2.66; text-transform: uppercase; } .MuiTypography-srOnly { width: 1px; height: 1px; overflow: hidden; position: absolute; } .MuiTypography-alignLeft { text-align: left; } .MuiTypography-alignCenter { text-align: center; } .MuiTypography-alignRight { text-align: right; } .MuiTypography-alignJustify { text-align: justify; } .MuiTypography-noWrap { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .MuiTypography-gutterBottom { margin-bottom: 0.35em; } .MuiTypography-paragraph { margin-bottom: 16px; } .MuiTypography-colorInherit { color: inherit; } .MuiTypography-colorPrimary { color: #0f69af; } .MuiTypography-colorSecondary { color: #503191; } .MuiTypography-colorTextPrimary { color: #000000; } .MuiTypography-colorTextSecondary { color: rgba(0, 0, 0, 0.54); } .MuiTypography-colorError { color: #ce0000; } .MuiTypography-displayInline { display: inline; } .MuiTypography-displayBlock { display: block; } .MuiGrid-container { width: 100%; display: flex; flex-wrap: wrap; box-sizing: border-box; } .MuiGrid-item { margin: 0; box-sizing: border-box; } .MuiGrid-zeroMinWidth { min-width: 0; } .MuiGrid-direction-xs-column { flex-direction: column; } .MuiGrid-direction-xs-column-reverse { flex-direction: column-reverse; } .MuiGrid-direction-xs-row-reverse { flex-direction: row-reverse; } .MuiGrid-wrap-xs-nowrap { flex-wrap: nowrap; } .MuiGrid-wrap-xs-wrap-reverse { flex-wrap: wrap-reverse; } .MuiGrid-align-items-xs-center { align-items: center; } .MuiGrid-align-items-xs-flex-start { align-items: flex-start; } .MuiGrid-align-items-xs-flex-end { align-items: flex-end; } .MuiGrid-align-items-xs-baseline { align-items: baseline; } .MuiGrid-align-content-xs-center { align-content: center; } .MuiGrid-align-content-xs-flex-start { align-content: flex-start; } .MuiGrid-align-content-xs-flex-end { align-content: flex-end; } .MuiGrid-align-content-xs-space-between { align-content: space-between; } .MuiGrid-align-content-xs-space-around { align-content: space-around; } .MuiGrid-justify-content-xs-center { justify-content: center; } .MuiGrid-justify-content-xs-flex-end { justify-content: flex-end; } .MuiGrid-justify-content-xs-space-between { justify-content: space-between; } .MuiGrid-justify-content-xs-space-around { justify-content: space-around; } .MuiGrid-justify-content-xs-space-evenly { justify-content: space-evenly; } .MuiGrid-spacing-xs-1 { width: calc(100% + 4px); margin: -2px; } .MuiGrid-spacing-xs-1 > .MuiGrid-item { padding: 2px; } .MuiGrid-spacing-xs-2 { width: calc(100% + 8px); margin: -4px; } .MuiGrid-spacing-xs-2 > .MuiGrid-item { padding: 4px; } .MuiGrid-spacing-xs-3 { width: calc(100% + 12px); margin: -6px; } .MuiGrid-spacing-xs-3 > .MuiGrid-item { padding: 6px; } .MuiGrid-spacing-xs-4 { width: calc(100% + 16px); margin: -8px; } .MuiGrid-spacing-xs-4 > .MuiGrid-item { padding: 8px; } .MuiGrid-spacing-xs-5 { width: calc(100% + 20px); margin: -10px; } .MuiGrid-spacing-xs-5 > .MuiGrid-item { padding: 10px; } .MuiGrid-spacing-xs-6 { width: calc(100% + 24px); margin: -12px; } .MuiGrid-spacing-xs-6 > .MuiGrid-item { padding: 12px; } .MuiGrid-spacing-xs-7 { width: calc(100% + 28px); margin: -14px; } .MuiGrid-spacing-xs-7 > .MuiGrid-item { padding: 14px; } .MuiGrid-spacing-xs-8 { width: calc(100% + 32px); margin: -16px; } .MuiGrid-spacing-xs-8 > .MuiGrid-item { padding: 16px; } .MuiGrid-spacing-xs-9 { width: calc(100% + 36px); margin: -18px; } .MuiGrid-spacing-xs-9 > .MuiGrid-item { padding: 18px; } .MuiGrid-spacing-xs-10 { width: calc(100% + 40px); margin: -20px; } .MuiGrid-spacing-xs-10 > .MuiGrid-item { padding: 20px; } .MuiGrid-grid-xs-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-xs-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-xs-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-xs-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-xs-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-xs-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-xs-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-xs-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-xs-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-xs-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-xs-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-xs-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-xs-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-xs-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } @media (min-width:600px) { .MuiGrid-grid-sm-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-sm-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-sm-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-sm-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-sm-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-sm-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-sm-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-sm-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-sm-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-sm-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-sm-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-sm-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-sm-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-sm-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:960px) { .MuiGrid-grid-md-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-md-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-md-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-md-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-md-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-md-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-md-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-md-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-md-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-md-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-md-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-md-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-md-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-md-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:1280px) { .MuiGrid-grid-lg-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-lg-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-lg-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-lg-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-lg-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-lg-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-lg-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-lg-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-lg-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-lg-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-lg-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-lg-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-lg-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-lg-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:1920px) { .MuiGrid-grid-xl-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-xl-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-xl-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-xl-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-xl-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-xl-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-xl-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-xl-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-xl-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-xl-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-xl-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-xl-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-xl-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-xl-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } .MuiLink-underlineNone { text-decoration: none; } .MuiLink-underlineHover { text-decoration: none; } .MuiLink-underlineHover:hover { text-decoration: underline; } .MuiLink-underlineAlways { text-decoration: underline; } .MuiLink-button { border: 0; cursor: pointer; margin: 0; outline: 0; padding: 0; position: relative; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiLink-button::-moz-focus-inner { border-style: none; } .MuiLink-button.Mui-focusVisible { outline: auto; } .jss314 { color: #000000; border: 1px solid #949494; font-size: 1rem; transition: all .3s; border-radius: 5px; background-color: #fff; } .jss314:hover:not(.jss321):not(.jss322) { box-shadow: 0 0 6px 0 #0f69af; border-color: #0f69af; } .jss315 { height: 46px; padding: 4px 12px 6px; box-sizing: border-box; border-radius: 5px; } @media (min-width:600px) { .jss315 { height: 38px; } } .jss315[type=date]::-webkit-clear-button { display: none; } .jss315[type=date]::-webkit-inner-spin-button { display: none; } .jss315[type=date]::-webkit-calendar-picker-indicator { margin: 0; } .jss315[type=password] { padding: 8px 12px 6px; font-size: 16px; font-family: sans-serif; letter-spacing: 1px; } .jss315::placeholder { color: #949494; } .jss315::-ms-clear { display: none; } .jss316:not(.jss322) { box-shadow: 0 0 6px 0 #0f69af; border-color: #0f69af; } .jss317 { background-color: #fff; } .jss318 { height: 34px; } .jss319 { height: 46px; font-size: 0.875rem; } .jss320 { height: auto; } .jss321 { color: #000000; border-color: #c9c9c9; background-color: #c9c9c9; } .jss322 { border: solid 1px #ce0000; box-shadow: inset 0 0 0 1px #ce0000; } @media all and (-ms-high-contrast:none) { .jss314 .MuiInputAdornment-root { margin: 0; } } .MuiFormLabel-root { color: #000000; padding: 0; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1; } .MuiFormLabel-root.Mui-focused { color: #0f69af; } .MuiFormLabel-root.Mui-disabled { color: rgba(0, 0, 0, 0.38); } .MuiFormLabel-root.Mui-error { color: #ce0000; } .MuiFormLabel-colorSecondary.Mui-focused { color: #503191; } .MuiFormLabel-asterisk.Mui-error { color: #ce0000; } .jss307 { color: #000000; margin: 0px 0px 4px; display: block; font-size: 0.875rem; } .jss308 { font-size: 0.75rem; } .jss309 { margin: 0px 0px 12px 4px; font-size: 0.875rem; } .jss310 { color: #ce0000; font-weight: 900; } .jss255 { width: 100%; height: 100%; margin: auto; display: flex; outline: none; position: relative; background: #ffffff; overflow-y: auto; flex-direction: column; } @media (min-width:960px) { .jss255 { height: auto; margin-left: auto; margin-right: auto; border-radius: 6px; } } @media (min-width:960px) { .jss256 { width: 510px; max-height: 300px; } } @media (min-width:960px) { .jss257 { width: 620px; max-height: 400px; } } @media (min-width:960px) { .jss258 { width: 840px; max-height: 600px; } } .jss259 { width: 100%; display: flex; padding: 16px 16px 0px 16px; align-items: flex-start; justify-content: space-between; } @media (min-width:960px) { .jss259 { padding: 32px 32px 0px 32px; } } .jss260 { padding: 24px 16px 16px 16px; } @media (min-width:960px) { .jss260 { padding: 24px 32px 32px 32px; } } .jss261 { width: calc(100% - 16px); } .jss262 { font-size: 1rem; } .jss263 { font-size: 0.625rem; } .jss264 { color: rgba(0, 0, 0, 0.38); } .jss265 { display: flex; } .jss266 { top: 15px; right: 15px; position: absolute; } .jss267 { top: 16px; right: 16px; position: absolute; } @media (min-width:960px) { .jss267 { top: 32px; right: 32px; } } .jss268 { margin-top: 24px; justify-content: flex-end; } @media (min-width:960px) { .jss268 { display: flex; margin-top: 32px; } } .jss268 > * { width: 100%; } .jss268 > * + * { margin-top: 16px; } @media (min-width:960px) { .jss268 > * + * { margin-top: 0; margin-left: 16px; } } @media (min-width:960px) { .jss268 > * { width: auto; } } .MuiButtonBase-root { color: inherit; border: 0; cursor: pointer; margin: 0; display: inline-flex; outline: 0; padding: 0; position: relative; align-items: center; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; justify-content: center; text-decoration: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiButtonBase-root::-moz-focus-inner { border-style: none; } .MuiButtonBase-root.Mui-disabled { cursor: default; pointer-events: none; } @media print { .MuiButtonBase-root { color-adjust: exact; } } .jss171 { } @media (min-width:0px) { .jss171 { width: 0%; display: none; } } @media (min-width:600px) { .jss171 { width: 50%; display: flex; } } .MuiTypography-root { margin: 0; } .MuiTypography-body2 { color: #000000; font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.43; } .MuiTypography-body1 { color: #000000; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.5; } .MuiTypography-caption { color: #000000; font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 0.9375; } .MuiTypography-button { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.75; text-transform: uppercase; } .MuiTypography-h1 { color: #000000; font-size: 1.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 0.42px; } .MuiTypography-h2 { color: #000000; font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 1.5px; text-transform: uppercase; } .MuiTypography-h3 { color: #000000; font-size: 1.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; } .MuiTypography-h4 { color: #000000; font-size: 2.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.235; } .MuiTypography-h5 { font-size: 1.5rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.334; } .MuiTypography-h6 { font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.6; } .MuiTypography-subtitle1 { font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.75; } .MuiTypography-subtitle2 { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.57; } .MuiTypography-overline { font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 2.66; text-transform: uppercase; } .MuiTypography-srOnly { width: 1px; height: 1px; overflow: hidden; position: absolute; } .MuiTypography-alignLeft { text-align: left; } .MuiTypography-alignCenter { text-align: center; } .MuiTypography-alignRight { text-align: right; } .MuiTypography-alignJustify { text-align: justify; } .MuiTypography-noWrap { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .MuiTypography-gutterBottom { margin-bottom: 0.35em; } .MuiTypography-paragraph { margin-bottom: 16px; } .MuiTypography-colorInherit { color: inherit; } .MuiTypography-colorPrimary { color: #0f69af; } .MuiTypography-colorSecondary { color: #503191; } .MuiTypography-colorTextPrimary { color: #000000; } .MuiTypography-colorTextSecondary { color: rgba(0, 0, 0, 0.54); } .MuiTypography-colorError { color: #ce0000; } .MuiTypography-displayInline { display: inline; } .MuiTypography-displayBlock { display: block; } .MuiLink-underlineNone { text-decoration: none; } .MuiLink-underlineHover { text-decoration: none; } .MuiLink-underlineHover:hover { text-decoration: underline; } .MuiLink-underlineAlways { text-decoration: underline; } .MuiLink-button { border: 0; cursor: pointer; margin: 0; outline: 0; padding: 0; position: relative; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiLink-button::-moz-focus-inner { border-style: none; } .MuiLink-button.Mui-focusVisible { outline: auto; } .MuiCollapse-root { height: 0; overflow: hidden; transition: height 300ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; } .MuiCollapse-entered { height: auto; overflow: visible; } .MuiCollapse-hidden { visibility: hidden; } .MuiCollapse-wrapper { display: flex; } .MuiCollapse-wrapperInner { width: 100%; } .jss228 { display: flex; padding-top: 16px; justify-content: center; } .jss229 { justify-content: center; } .jss101 { width: 100%; z-index: 999; position: absolute; overflow-y: auto; padding-top: 12px; background-color: #fff; } @media (min-width:960px) { .jss101 { top: 44px; width: 100%; height: auto !important; box-shadow: 0px 6px 13px 0px rgba(0, 0, 0, 0.16); padding-top: 0; } } .jss102 { overflow: hidden; } .jss102 > * { border-top: 1px solid #e4e4e4; margin-top: -1px; } .jss103 { display: none; padding: 8px 16px 4px; align-items: center; } @media (min-width:600px) { .jss103 { display: flex; } } .jss104 { color: #fff; display: flex; padding: 2px 6px; font-size: 0.6875rem; font-weight: 900; border-radius: 3px; letter-spacing: 0.5px; text-transform: uppercase; background-color: #0f69af; } .jss105 { font-weight: 700; padding-left: 8px; } .jss106 { padding: 4px 0px 8px; } .jss106:empty { display: none; } .jss107 { margin: 8px 0px 2px 12px; font-size: 0.75rem; font-weight: 900; padding-left: 4px; border-bottom: 1px solid #e4e4e4; padding-bottom: 2px; } .jss108 { padding: 3px 20px; font-size: 0.875rem; } .jss109 { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .jss110 { width: 100%; display: flex; justify-content: space-between; } .jss110 > button { display: none; } .jss110.Mui-selected > button { display: none; } @media (min-width:960px) { .jss110.Mui-selected > button { display: block; } } @media (min-width:960px) { .jss110:hover > button { display: block; } } .jss111 { height: 500px; } .jss111 > button { display: block; } .jss112 { display: none; padding: 0; font-size: 0.75rem; } @media (min-width:960px) { .jss112 { display: flex; } } .jss113 { display: none; font-weight: 400; } @media (min-width:960px) { .jss113 { display: inline; } } .jss114 { margin-left: 4px; } .jss76 { width: 100%; position: relative; } .jss69 { display: block; } @media (max-width: 959px) { .jss69 { max-width: 100px; } } .MuiDrawer-docked { flex: 0 0 auto; } .MuiDrawer-paper { top: 0; flex: 1 0 auto; height: 100%; display: flex; outline: 0; z-index: 1200; position: fixed; overflow-y: auto; flex-direction: column; -webkit-overflow-scrolling: touch; } .MuiDrawer-paperAnchorLeft { left: 0; right: auto; } .MuiDrawer-paperAnchorRight { left: auto; right: 0; } .MuiDrawer-paperAnchorTop { top: 0; left: 0; right: 0; bottom: auto; height: auto; max-height: 100%; } .MuiDrawer-paperAnchorBottom { top: auto; left: 0; right: 0; bottom: 0; height: auto; max-height: 100%; } .MuiDrawer-paperAnchorDockedLeft { border-right: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedTop { border-bottom: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedRight { border-left: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedBottom { border-top: 1px solid rgba(0, 0, 0, 0.12); } .jss115 { margin-bottom: 8px; } .jss116 { margin-bottom: 16px; } .jss117 { margin-bottom: 24px; } .jss118 { color: #000000; display: flex; padding: 0px 20px 0px 8px; font-size: 0.875rem; align-items: center; font-weight: 900; border-right: 2px solid rgba(0, 0, 0, 0.25); } .jss119 { padding: 0px 0px 0px 20px; font-size: 0.875rem; font-weight: 900; } .jss120 { color: #000000; width: 1rem; height: 1rem; margin-left: .2rem; margin-right: .5rem; } .jss121 { top: 1.9rem !important; z-index: 900 !important; } .jss122 { top: 1.2rem; color: #000; right: 4rem; position: absolute; } .jss123 { width: 1.6875rem; height: 1.6875rem; } .jss124 { font-size: 1.25rem; font-weight: 900; text-transform: uppercase; } .jss125 { font-size: 0.875rem; } .jss126 { z-index: 2500 !important; position: relative; min-width: 9.375rem; margin-top: 8px; } .jss127 { font-size: 0.875rem; min-height: 40px; padding-right: 20px; } .jss128 { cursor: pointer; padding: 8px 0px 8px 24px; font-size: 0.875rem; font-weight: 900; } .jss129 { width: 100%; display: flex; align-self: center; flex-direction: column; } .jss130 { width: 50%; height: inherit; max-width: 18.125rem; min-width: 8.75rem; margin-top: 12px; margin-bottom: 24px; } .jss131 { margin-left: 40px; } .jss132 { border: 1px solid #757575; height: 11.375rem; padding: 0; max-width: 18.125rem; overflow-y: scroll; border-radius: 3px; } .jss133 { overflow-y: hidden; } .jss134 { color: #fff; width: 9rem; height: 2.5rem; align-self: flex-end; background-color: #210953; } .jss136 { right: 0; } .jss137 { height: 100%; overflow: hidden; position: relative; } .jss138 { height: calc(100% - 80px); overflow-y: auto; } .jss139 { color: #000; padding: 0px 20px 20px; } .jss140 { width: 100%; display: flex; padding: 16px; align-items: center; border-bottom: 1px solid #503191; margin-bottom: 24px; justify-content: flex-end; } .jss140 > * + * { margin-left: auto; } .jss141 { color: #503191; font-size: 0.75rem; font-weight: 900; } .jss142 { color: #503191; font-size: 1.25rem; } .jss143 { color: #503191; font-size: 1.5rem; } .jss144 { border-bottom: 1px solid #503191; margin-bottom: 28px; padding-bottom: 12px; } .jss145 { color: #000; width: 100%; display: flex; font-size: 1.125rem; text-align: left; font-weight: 900; margin-bottom: 16px; justify-content: space-between; } .jss146 { font-size: 0.875rem; } .jss147 { color: #503191; font-size: 1.375rem; } .jss148 { color: #000; } .jss149 { color: #000; display: flex; font-size: 0.875rem; align-items: center; } .jss150 { font-size: 0.875rem; } .jss151 { color: #949494; font-size: 0.75rem; } .jss152 { min-width: 54px; } .jss153 { left: 16px; bottom: 16px; position: fixed; } .jss154 { margin-bottom: 4px; } .jss155 { margin-bottom: 16px; } .jss156 { margin-bottom: 24px; } .jss157 { height: 100%; } .jss157 > svg { font-size: 90px; } .jss14 { border-bottom: 1px solid #503191; padding-bottom: 12px; background-color: #fff; } @media (min-width:960px) { .jss14 { display: none; } } .jss15 { color: #503191; display: inline-flex; margin-left: auto; margin-right: 8px; } @media (min-width:960px) { .jss15 { display: none; } } .jss16 { display: none; } @media (min-width:960px) { .jss16 { display: flex; } } .jss17 { width: 100%; display: flex; padding: 0px 16px; position: relative; box-shadow: 0px 10px 10px -10px rgba(0,0,0,0.04); align-items: center; justify-content: space-between; } @media (min-width:960px) { .jss17 { padding: 16px 80px; } } .jss18 { display: flex; align-items: center; } .jss19 { display: none; } @media (min-width:960px) { .jss19 { color: #fff; width: 100%; height: 48px; display: flex; padding: 0px 80px; position: relative; background: #503191; box-shadow: 0 3px 8px 0 rgba(0, 0, 0, 0.16); align-items: center; } } .jss20 { height: 100%; display: flex; flex-grow: 1; align-items: center; justify-content: flex-end; } .jss21 { color: #fff; height: 1.125rem; flex-shrink: 0; font-weight: 900; border-right: 2px solid rgb(102 83 143); padding-left: 16px; padding-right: 16px; } .jss21:hover { color: #fff; } .jss22 { color: #fff; min-width: 7.3rem; font-weight: 900; padding-left: 20px; } .jss23 { color: #fff; height: 1.125rem; font-size: 0.875rem; font-weight: 900; padding-right: 16px; } .jss23:hover { color: #fff; } .jss23:not(:first-child) { padding-left: 16px; } .jss23:not(:last-child) { border-right: 2px solid rgb(102 83 143); } .jss24 { color: #fff; } .jss24:hover { color: #fff; } .jss25 { top: 0.0625rem; position: relative; font-size: 1.25rem; transform: rotate(0deg); transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 0.125rem; } .jss26 { transform: rotate(180deg); } .jss27 { cursor: pointer; display: flex; position: relative; font-size: 1.5rem; margin-right: 16px; } @media (min-width:960px) { .jss27 { display: none; } } .jss28 { top: 8.3rem !important; } .jss29 { height: calc(100vh - 56px); padding: 48px 64px 36px; background-color: #281949; } .jss29:focus { outline: none; } .jss30 { height: 100%; } .jss31 { top: 20px; right: 20px; position: absolute; } .jss32 { font-size: 28px; } .jss33 { margin-top: 12px; border-left: 1px solid #503191; } .jss33.MuiGrid-item { padding: 12px 28px; } .jss34 { height: 100%; overflow: auto; } .jss35 { font-size: 2.5rem; font-weight: 900; line-height: 1; } .jss36 { color: #fff; width: 100%; display: flex; font-size: 1rem; transition: color 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; align-items: center; font-weight: 400; margin-bottom: 24px; justify-content: space-between; } .jss36:hover { color: #9684BD; } .jss36 div { display: flex; } .jss37 { font-weight: 900; } .jss37:hover { color: #fff; } .jss38 { min-width: 196px; } .jss39 { font-size: 0.8125rem; min-height: 40px; } .jss40 { top: 4px; color: #8264c3; right: 4px; position: absolute; } .jss41 { padding: 0.5rem; border-radius: 5px; background-color: #0f69af; } .jss41:hover { background-color: #003f71; } .jss42 { color: #fff; } .jss43 { font-size: 1.1875rem; font-weight: 400; justify-content: flex-start; } .jss44 { padding: 0; flex-direction: row-reverse; } .jss45.expanded { transform: rotate(90deg); } .jss46 { display: flex; justify-content: center; } .jss47 { border-color: #e6e6ea; background-color: #e6e6ea; } .jss48 { height: inherit; padding-left: 16px; } .jss49 { height: 2.25rem; box-sizing: border-box; } .jss49::placeholder { opacity: 1 !important; font-size: 0.875rem; line-height: normal; } .jss49:focus::placeholder { color: transparent; } .jss50 { color: #000; width: 100%; border: 1px solid #616161; height: 2.375rem; display: flex; max-width: 700px; align-items: center; border-radius: 4px; justify-content: space-between; } .jss51 { top: 3.6rem; width: 50%; display: flex; padding: 16px 0px; z-index: 1200; position: absolute; max-width: 43.75rem; box-shadow: 0px 6px 13px 0px rgba(0, 0, 0, 0.16); overflow-y: auto; flex-direction: column; } @media (max-width:959.95px) { .jss51 { width: 30%; max-height: 540px; } } .jss52 { padding: 8px 8px 8px 16px; font-size: 0.75rem; font-weight: 900; } .jss53 { padding: 4px 8px 4px 32px; font-size: 0.875rem; } .jss53:hover { background-color: #e8f3fa; } .jss54 { color: #fff; width: 2.3rem; height: 100%; background-color: #210953; } .jss55 { height: 60%; } .jss56 { display: flex; font-size: 0.8125rem; align-items: center; flex-shrink: 0; font-weight: 900; line-height: 1; } .jss57 { cursor: pointer; } .jss58 { border: 1px solid #503191; display: flex; padding: 5px; font-size: 0.8125rem; min-width: 26px; align-items: center; margin-left: 12px; border-radius: 5px; justify-content: center; background-color: #503191; } .jss59 { color: #0f69af; padding: 4px 0px 4px 32px; font-size: 0.875rem; font-weight: 900; } .jss60 { flex-grow: 1; margin-right: 16px; } .jss61 { height: 48px; display: flex; font-size: 100px; } @media (min-width:960px) { .jss61 { font-size: 150px; } } .jss61 a { height: 48px; display: flex; } .jss62 { display: none; } @media (min-width:960px) { .jss62 { width: 100%; display: flex; margin-left: 20px; justify-content: center; } } @media (min-width:1280px) { .jss62 { margin: 0px 40px; } } .jss63 { display: none; } @media (min-width:960px) { .jss63 { display: flex; align-items: center; justify-content: flex-end; } } .jss64 { display: block; } @media (min-width:960px) { .jss64 { display: none; } } .jss70 { color: #fff; font-size: 0.875rem; margin-right: .5rem; } .jss71 { color: #503191; cursor: pointer; display: flex; padding: 0; font-size: 0.875rem; background: transparent; align-items: center; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; border-color: transparent; } .jss71:focus { outline: none; } @media (min-width:960px) { .jss71 { color: #fff; } } .jss72 { display: flex; font-size: 24px; } @media (min-width:960px) { .jss72 { height: 19px; font-size: 22px; margin-right: 8px; } } .jss73 { display: none; } @media (min-width:960px) { .jss73 { display: inline; } } .jss74 { color: #503191; border: 1px solid #503191; height: 1.5rem; display: flex; font-size: 0.8125rem; min-width: 1.5rem; align-items: center; font-weight: 900; line-height: 1.5rem; margin-left: 8px; border-radius: 5px; justify-content: center; } @media (min-width:960px) { .jss74 { color: #000; font-size: 0.6875rem; margin-left: 12px; background-color: #fff; } } .jss75 { display: none; } @media (min-width:960px) { .jss75 { display: flex; } } .jss172:hover { color: #000000; background-color: #FFFFFF; } .jss172.jss177 { color: #000000; background-color: #FFFFFF; } .jss173 { display: inline-flex; padding: 0 16px; font-size: 0.875rem; align-items: center; font-weight: 900; line-height: 1; justify-content: center; } .jss174.jss177 { transform: rotate(180deg); } .jss158 { height: 100%; } .jss159 { color: #000; outline: none !important; padding: 15px 16px 30px; z-index: 2; background-color: #fff; } .jss159:before { top: -56px; left: 0; width: 100%; height: 56px; content: ""; position: absolute; box-shadow: 0 3px 8px 0 rgba(0, 0, 0, 0.16); pointer-events: none; } .jss159:after { top: 0; left: 0; width: 100%; height: 100%; content: ""; z-index: -1; position: absolute; box-shadow: 0 6px 12px 0 rgba(0, 0, 0, 0.16); } .jss159.jss162:before { display: none; } .jss160 { margin: 0 auto; outline: none !important; max-width: 1280px; } .jss161 { margin: -8px 0 -8px -20px; outline: none !important; min-width: 284px; } .jss164 { height: 100%; display: flex; padding: 8px 0; border-right: 2px solid rgba(201,201,201,0.25); flex-direction: column; } .jss164.jss163 { border-right: none; } .jss165 { color: #000000; width: 24px; height: 24px; margin: 0 14px 0 auto; padding: 0; min-width: 24px; } .jss166 { font-size: 24px; } .jss167 { width: 100%; padding: 8px 14px 8px 20px; font-size: 1rem; text-align: left; font-weight: 900; } .jss168 { margin: 0 14px 32px 20px; } .jss169 { width: 100%; display: block; margin-bottom: 8px; } .jss170 { font-size: 1rem; font-weight: 900; } .MuiContainer-root { width: 100%; display: block; box-sizing: border-box; margin-left: auto; margin-right: auto; padding-left: 16px; padding-right: 16px; } @media (min-width:600px) { .MuiContainer-root { padding-left: 40px; padding-right: 40px; } } .MuiContainer-disableGutters { padding-left: 0; padding-right: 0; } @media (min-width:600px) { .MuiContainer-fixed { max-width: 600px; } } @media (min-width:960px) { .MuiContainer-fixed { max-width: 960px; } } @media (min-width:1280px) { .MuiContainer-fixed { max-width: 1280px; } } @media (min-width:1920px) { .MuiContainer-fixed { max-width: 1920px; } } @media (min-width:0px) { .MuiContainer-maxWidthXs { max-width: 444px; } } @media (min-width:600px) { .MuiContainer-maxWidthSm { max-width: 600px; } } @media (min-width:960px) { .MuiContainer-maxWidthMd { max-width: 960px; } } @media (min-width:1280px) { .MuiContainer-maxWidthLg { max-width: 1280px; } } @media (min-width:1920px) { .MuiContainer-maxWidthXl { max-width: 1920px; } } .jss413 { color: #c9c9c9; padding: 0px 8px; } .jss414 { cursor: pointer; } .jss392 { width: 100%; padding: 20px 0px; background: #f3f3f7; } @media (min-width:960px) { .jss392 { padding: 40px 0px; } } .jss393 { margin: 0 auto; padding: 0px 20px; max-width: 1320px; } .jss394 { display: none; margin-bottom: 50px; } @media (min-width:960px) { .jss394 { display: flex; } } .jss395 { height: 200px; flex-grow: 1; border-right: 1px solid rgba(0, 0, 0, 0.26); } .jss396 { width: 100%; max-width: 200px; margin-right: 20px; } .jss396 h2 { margin: 0; font-size: 1rem; font-weight: 900; } .jss397 { display: block; font-size: 0.875rem; margin-top: 20px !important; font-weight: 900; line-height: 0.93; } .jss398 { margin: 7px -7px 8px -8px; display: flex; flex-wrap: wrap; } .jss399 { margin: 8px 8px 7px 7px; flex-shrink: 0; } .jss400 { width: 100%; max-width: 330px; margin-left: 68px; } .jss400 h2 { font-size: 16px; font-weight: 900; margin-bottom: 8px; } .jss401 { display: none; border-top: 2px solid rgba(0, 0, 0, 0.10); min-height: 80px; align-items: center; border-bottom: 2px solid rgba(0, 0, 0, 0.10); } @media (min-width:960px) { .jss401 { display: flex; } } .jss402 { max-width: 75px; max-height: 75px; flex-shrink: 0; } .jss403 { color: #000 !important; font-size: 1rem; font-weight: 900; line-height: 1.06; margin-left: 75px !important; } .jss404 { font-size: 0.75rem; margin-top: 0; } @media (min-width:960px) { .jss404 { margin-top: 32px; } } .jss404 p { margin: 0; } .jss405 { font-weight: 900; } .jss406 { display: block; } @media (min-width:960px) { .jss406 { display: flex; } } .jss407 { margin-right: 0; } @media (min-width:960px) { .jss407 { margin-right: 8px; } } .jss408 { margin-top: 2px; } @media (min-width:960px) { .jss408 { margin-top: 0; } } .jss409 { font-weight: 900; } .jss410 { color: #c9c9c9; padding: 0px 8px; } .jss411 { display: block; margin-bottom: 0; } .jss412 { display: block; margin-bottom: 0; } .jss328 { color: #0f69af; font-size: 0.875rem; font-weight: 900; } .jss328:hover, .jss328:focus-visible { color: #003f71; } .jss328:focus-visible { outline: revert; outline-offset: 2px; } .jss329 { font-size: 0.75rem; } .jss330 { font-size: 1rem; } .jss331 { font-size: 0; margin-right: 8px; } .jss4 { position: relative; } .jss5 { display: flex; padding: 8px 16px; align-items: flex-start; } @media (min-width:960px) { .jss5 { padding: 8px 32px; } } .jss6 { display: flex; align-items: baseline; } .jss7 { display: flex; align-items: baseline; } .jss7 > * + .jss6 { border-left: 1px solid #fff; margin-left: 16px; margin-right: 8px; padding-left: 16px; } .jss8 { color: #000; padding: 4px 0px 0px 8px; font-size: 0.875rem; margin-left: auto; } .jss9 { white-space: nowrap; } .jss9:disabled { opacity: 0.5; } .jss10 { color: #fff; background: #ce0000; border-bottom: 1px solid #eeeeee; } .jss10 a { color: #fff; text-decoration: underline; } .jss11 { background: #f7a703; border-bottom: 1px solid #eeeeee; } .jss12 { background: #fff; border-bottom: 1px solid #eeeeee; } .jss13 { color: #fff; background: #0f69af; border-bottom: 1px solid #eeeeee; } .jss13 .jss8 { color: #fff; } .jss13 .jss9 { color: #fff; } .jss13 .jss9:hover { color: #fff; text-decoration: underline; } .jss13 .jss9:focus { color: #fff; } .jss1 { height: 100%; display: flex; min-height: 1px; flex-direction: column; } .jss2 { flex: 1 0 auto; } .jss3 { flex-shrink: 0; } .jss387 { border-top: 1px solid #e4e4e4; padding-top: 8px; } .jss367 { color: #0f69af; cursor: pointer; } .jss358 { padding: 24px 16px; border-bottom: 1px solid #c9c9c9; } @media (min-width:960px) { .jss358 { padding: 32px 16px; } } .jss359 { font-size: 1rem; font-weight: 900; line-height: 1.25; margin-bottom: 8px; } @media (min-width:960px) { .jss359 { font-size: 1.5rem; margin-bottom: 8px; } .jss359 > a > span { font-weight: 700; } } @media (min-width:960px) { .jss360 { font-size: 1rem; } } @media (min-width:960px) { .jss361 { margin-bottom: 16px; } } @media (min-width:960px) { .jss362 { margin-bottom: 16px; } } .jss363 { padding-right: 8px; } .jss364 { font-size: 0.75rem; font-style: italic; margin-bottom: 16px; } @media (min-width:960px) { .jss365 { margin-bottom: 8px; } } .jss366 { margin: 0; } @media (min-width:960px) { .jss358 { padding: 0px 0px 8px 0px; border-bottom: none; } } .jss389 { color: #fff; right: 24px; width: 56px; bottom: 126px; height: 56px; display: flex; z-index: 2; position: fixed; box-shadow: 0 2px 4px rgba(0,0,0,.2); align-items: center; border-radius: 5px; flex-direction: column; text-transform: uppercase; justify-content: center; background-color: #0f69af; } .jss390 { font-size: 28px; margin-top: -5px; } .jss391 { font-size: 14px; margin-top: -6px; } .jss356 { margin-bottom: 0; } @media (min-width:960px) { .jss356 { margin-top: 16px; } } .jss357 { margin-bottom: 16px; } @media (min-width:960px) { .jss357 { margin-bottom: 8px; } } .jss269 { width: 100%; border: none; display: flex; padding: 32px 0px; background: none; text-align: left; align-items: center; justify-content: space-between; } @media (min-width:960px) { .jss269 { padding: 32px 0px 20px; } } .jss270:hover { cursor: pointer; } .jss271 { padding-bottom: 32px; } .jss272 { font-size: 12px; transition: transform 0.25s; } .jss273 { transform: rotate(180deg); } .jss355 > div > div { padding-top: 0; padding-left: 0; padding-bottom: 16px; } .jss350 { margin: 0; padding: 0; margin-bottom: 4px; list-style-type: none; margin-block-start: 0; padding-inline-start: 0; } .jss351 { padding: 16px 16px 32px; } @media (min-width:600px) { .jss351 { padding: 40px; } } .jss352 { color: #0f69af; display: flex; font-size: 1rem; align-items: center; font-weight: 900; } .jss353 { padding: 0; font-size: 1.125rem; transform: rotate(0deg); transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; } .jss354 { transform: rotate(180deg); } .jss230 { display: flex; flex-direction: column; } @media (min-width:960px) { .jss230 { padding-top: 16px; margin-bottom: 16px; } } .jss231 { height: 88px; } .jss232 { height: calc(100vh - 124px); display: flex; justify-content: center; } @media (min-width:960px) { .jss232 { height: 428px; } } .jss233 { width: 100%; height: 100%; display: flex; padding: 0px 48px; flex-direction: column; } @media (min-width:960px) { .jss233 { padding: 0px 64px; flex-direction: row; } } .jss234 { display: flex; padding: 16px 0px; align-items: center; flex-direction: column; justify-content: center; } @media (min-width:960px) { .jss234 { display: block; padding: 0; text-align: center; } } .jss235 { width: 100%; height: 92%; } @media (min-width:960px) { .jss235 { width: 50%; height: 100%; } } .jss236 { width: 100%; height: 100%; } .jss237 { border: solid 1px #c9c9c9; margin: 0 auto; max-width: 100%; max-height: 100%; touch-action: none; } @media (min-width:960px) { .jss237 { top: 50%; position: relative; transform: translateY(-50%); } } .jss238 { height: 8%; display: flex; align-items: center; justify-content: center; } @media (min-width:960px) { .jss238 { width: 50%; height: 428px; padding: 16px 0px 16px 24px; justify-content: flex-start; } } .jss239 { display: none; position: relative; max-height: 428px; padding-left: 12px; } .jss239:before { top: 2px; left: 0; width: 4px; height: 14px; content: ''; position: absolute; background-color: #503191; } @media (min-width:960px) { .jss239 { display: block; } } .jss240 { overflow: auto; max-height: 428px; word-break: break-word; } .jss241 { overflow: scroll; } .jss242 sup, .jss242 sub { top: -0.4em; position: relative; vertical-align: baseline; } .jss242 sub { top: 0.1em; } .jss243 { display: flex; justify-content: center; } @media (min-width:960px) { .jss243 { display: none; } } .jss244 { width: 2rem; border: 0; height: 4rem; box-shadow: 0px 3px 5px -1px rgba(0,0,0,0.0),0px 5px 8px 0px rgba(0,0,0,0.14),0px 1px 14px 0px rgba(0,0,0,0.12); background-color: #fff; } .jss245 { border-radius: 0 5px 5px 0; } .jss246 { border-radius: 5px 0 0 5px; } .jss247 { font-size: 2.125rem; } .jss248 { display: flex; align-items: center; } .jss249 { width: 54px; height: 54px; margin: 0 auto; display: block; position: relative; border-radius: 2px; } .jss250 { border: solid 2px #0f69af; } .jss251 { max-width: 100%; max-height: 100%; } .jss252 { top: 0; left: 0; right: 0; bottom: 0; position: absolute; background-color: rgba(0, 0, 0, .3); } .jss253 { margin: 0 auto; max-width: 350px; } .jss209 { margin-right: 8px; margin-bottom: 8px; } .jss209 sup { font-size: 75%; vertical-align: top; } .jss210 { width: auto; height: auto; max-width: 100%; max-height: 100%; margin-left: 8px; } .jss211 { width: 100%; height: 100%; display: flex; } .jss212 { display: flex; margin-bottom: 8px; flex-direction: row; } .jss213 { font-weight: 900; } .jss214 { color: #949494; font-weight: 900; margin-left: 8px; } .jss215 { display: flex; align-items: center; margin-bottom: 8px; } .jss216 { display: flex; flex-wrap: wrap; } .jss217 { font-size: 0.875rem; font-weight: 400; margin-left: 8px; } .jss219 { font-weight: 700; margin-bottom: 4px; } .jss220 { font-size: 0.75rem; } .jss221 { font-weight: 700; margin-bottom: 4px; } .jss222 { font-size: 0.75rem; } .jss223 { align-items: center; margin-bottom: 24px; } .jss224 { font-weight: 700; margin-bottom: 4px; } .jss225 { font-size: 0.625rem; margin-left: 8px; } .jss226 { font-size: 0.875rem; font-weight: 900; } @media (min-width:600px) { .jss223 { margin-bottom: 8px; } .jss224 { margin-bottom: 0; } } .jss192 { margin-bottom: 24px; } @media (min-width:600px) { .jss193 { margin-bottom: 24px; } } .jss194 { margin-bottom: 24px; } @media (min-width:600px) { .jss194 { margin-bottom: 8px; } } .jss195 { order: 2; } @media (min-width:600px) { .jss195 { order: 1; } } .jss196 { order: 1; } @media (min-width:600px) { .jss196 { order: 2; } } @media (min-width:600px) { .jss197 { display: none; } } @media (max-width:599.95px) { .jss198 { display: none; } } @media (min-width:600px) { .jss199 { margin-bottom: 32px; } } .jss200 { width: 100%; height: 100%; display: block; } .jss201 { width: 288px; margin: 0 auto; } @media (min-width:600px) and (max-width:959.95px) { .jss201 { width: 100px; } } @media (min-width:960px) and (max-width:1279.95px) { .jss201 { width: 135px; } } @media (min-width:1280px) { .jss201 { width: 180px; } } .jss202 { color: #0f69af; font-weight: 900; text-decoration: none; } .jss202:hover { cursor: pointer; } .jss203 { width: 288px; border: solid 1px #c9c9c9; height: 288px; margin: 0 auto; display: flex; border-radius: 5px; margin-bottom: 12px; justify-content: center; background-color: #fff; } @media (min-width:600px) and (max-width:959.95px) { .jss203 { width: 100px; height: 100px; } } @media (min-width:960px) and (max-width:1279.95px) { .jss203 { width: 135px; height: 135px; } } @media (min-width:1280px) { .jss203 { width: 170px; height: 170px; } } .jss204 { width: auto; height: auto; max-width: 100%; max-height: 100%; } .jss205 { padding-left: 0.25rem; } .jss206 { padding: 0px 16px; } @media (min-width:600px) { .jss206 { padding: 0; } } .jss207 { border-bottom: 1px solid #c9c9c9; margin-bottom: 24px; } @media (min-width:600px) { .jss207 { border: none; margin: 0; } } .jss388 { margin-bottom: 32px; } .jss290 { margin-bottom: 4px; } .jss291 { font-weight: 900; } .jss292 { padding-top: 6px; margin-bottom: 4px; } .jss292 img { max-width: 32px; margin-right: 10px; } .jss293 { word-break: break-word; } .jss311 { position: relative; } .jss312 { left: 0; right: 0; z-index: 1; position: absolute; margin-top: 8px; max-height: 268px; overflow-y: auto; } .jss313 { font-size: 0.875rem; padding-left: 12px; padding-right: 12px; } .jss332 { cursor: pointer; font-size: 1rem; } .jss333 { flex: 1; padding: 16px; overflow-y: scroll; } @media (min-width:960px) { .jss333 { padding: 32px 32px 48px; } } .jss334 { margin: 0px 0px 24px; padding-left: 20px; } .jss334 li:not(:last-child) { margin-bottom: 8px; } .jss335 { margin-bottom: 8px; } .jss336 { margin-bottom: 16px; } .jss337 { margin-bottom: 24px; } .jss323 { flex: 1; padding: 16px; overflow-y: scroll; } @media (min-width:960px) { .jss323 { padding: 32px 32px 48px; } } .jss324 { margin: 0px 0px 24px; padding-left: 20px; } .jss324 li:not(:last-child) { margin-bottom: 8px; } .jss325 { margin-bottom: 8px; } .jss326 { margin-bottom: 16px; } .jss327 { margin-bottom: 24px; } .jss297 { display: block; margin-bottom: 4px; } @media (min-width:600px) { .jss297 { display: flex; align-items: center; } } .jss298 { margin-top: 4px; } @media (min-width:600px) { .jss298 { margin-top: 0; border-left: solid 1px #c9c9c9; margin-left: 16px; padding-left: 16px; } } .jss299 { width: 100%; } @media (min-width:600px) { .jss299 { width: auto; } } .jss300 { color: #0f69af; font-size: 1rem; font-weight: 900; text-decoration: none; } .jss300:hover { cursor: pointer; } .jss301 { height: 150px; padding: 16px; } @media (min-width:960px) { .jss301 { padding: 32px; } } .jss302 { top: 4px; left: 8px; cursor: pointer; position: relative; } .jss303 { opacity: 0.64; } .jss304 { margin-bottom: 8px; } .jss305 { margin-bottom: 16px; } .jss306 { font-size: 0.875rem; margin-bottom: 24px; } .jss338 { margin-bottom: 5px; text-transform: capitalize; } .jss339 { font-size: 1rem; } .jss339:.MuiGrid-item { padding-top: 0; padding-bottom: 0; } .jss339 .MuiGrid-item { padding-top: 0; padding-bottom: 0; } .jss340 { color: #0f69af; font-size: 0.875rem; margin-top: 16px; font-weight: 900; } @media (min-width:960px) { .jss340 { font-size: 1rem; } } .jss340:last-of-type { padding-bottom: 0; } .jss341 { font-size: 0.625rem; transform: rotate(0deg); margin-top: 2px; transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 4px; } .jss342 { transform: rotate(180deg); } .jss343 { padding-bottom: 12px; } .jss294 { margin-bottom: 16px; text-transform: capitalize; } @media (min-width:960px) { .jss295 { padding-right: 32px; } } .jss296 { font-size: 1rem; } .jss185 { display: flex; padding: 16px 20px; margin-bottom: 32px; background-color: #e8f3fa; } @media (min-width:960px) { .jss185 { padding: 8px; align-items: center; justify-content: center; } } .jss186 { display: flex; margin-top: 4px; } @media (min-width:960px) { .jss186 { margin-top: 0; } } .jss187 { display: block; } @media (min-width:960px) { .jss187 { display: flex; align-items: center; } } .jss188 { font-size: 1rem; margin-right: 12px; } @media (min-width:960px) { .jss188 { margin-right: 12px; } } .jss189 { font-weight: 900; } @media (min-width:960px) { .jss190 { padding: 0px 12px; } } .jss191 { display: block; font-size: 0.875rem; margin-top: 4px; } @media (min-width:960px) { .jss191 { margin-top: 0; } } .jss344 { margin-bottom: 8px; } .jss345 { margin-bottom: 16px; } .jss346 { margin-bottom: 24px; } .jss347 { margin-bottom: 32px; } .jss348 { width: 100%; } @media (min-width:600px) { .jss348 { width: auto; } } .jss349 { padding: 12px 0px; } .jss368 { padding: 16px 16px 32px; } @media (min-width:600px) { .jss368 { padding: 40px; } } .jss369 { width: 100%; } .jss370 { height: 2.8125rem; display: flex; align-items: center; } .jss370 > * { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .jss370 > *:nth-child(1) { width: 12%; } .jss370 > *:nth-child(2) { width: 14%; flex-shrink: 0; } .jss370 > *:nth-child(3) { width: 38%; flex-shrink: 0; } .jss370 > *:nth-child(4) { width: 13%; flex-shrink: 0; } .jss370 > *:nth-child(5) { width: 13%; flex-shrink: 0; } .jss370 > *:nth-child(6) { width: 6.25rem; text-align: center; flex-shrink: 0; padding-right: 0 !important; } .jss370 > *:not(:last-child) { padding-right: 12px; } .jss371 { font-size: 0.6875rem; font-weight: 400; padding-top: 16px; } .jss372 { padding-bottom: 16px; } .jss373 { padding: 0px 16px; margin-top: 16px; } .jss374 { min-width: 136px; } .jss375 { width: 550px; border: 4px solid grey; height: auto; z-index: 1; position: relative; min-height: auto; } .jss376 { width: 100%; height: 50px; display: flex; padding: 5px 10px; align-items: center; font-weight: 700; flex-direction: row; background-color: rgba(0,0,0,0.04); } .jss377 { color: #616161; right: 0.625rem; cursor: pointer; position: absolute; } .jss378 { width: 100%; height: 55%; margin: auto; padding: 10px 8px; font-size: 0.75rem; } .jss379 { margin: 0; padding: 0; list-style: none; } .jss379 li { position: relative; } .jss380 { opacity: 0.6; text-decoration: line-through; } .jss381 { display: flex; padding: 12px; font-size: 0.75rem; background-color: #f8f8f8; } .jss381 > * { display: flex; align-items: center; padding-right: 8px; } .jss381 > * > * { overflow: hidden; max-width: 100%; white-space: nowrap; text-overflow: ellipsis; } .jss381 > *:nth-child(1) { width: 12%; } .jss381 > *:nth-child(2) { width: 14%; } .jss381 > *:nth-child(3) { width: 35%; flex-grow: 1; flex-shrink: 2; } .jss381 > *:nth-child(4) { flex: 0 0 auto; width: 5%; justify-content: center; } .jss381 > *:nth-child(5) { width: 16.25rem; justify-content: flex-end; } .jss382 { flex: 1 1 auto; display: flex; align-items: center; justify-content: flex-end; } .jss383 { margin: 0; padding: 0px 8px; min-width: 0; background: none !important; } .jss383 * { color: #503191; } .jss384 { display: -webkit-box; overflow: hidden; white-space: inherit; -webkit-box-orient: vertical; -webkit-line-clamp: 2; } .jss385 { flex: 1 1 auto; color: #ce0000; font-size: 0.6875rem; text-align: right; font-weight: 400; } .jss386 > * { word-break: break-word; white-space: normal; } .jss286 { margin-bottom: 16px; } @media (min-width:1280px) { .jss287 { margin-right: 410px; } } .jss288:not(:last-child) { margin-bottom: 24px; } .jss289 { word-break: break-word; } .jss289:not(:last-child) { margin-bottom: 8px; } .jss289 *:not(a) { cursor: default; pointer-events: none; } .jss289 a { pointer-events: initial; } .jss289 ul { margin-left: 0; padding-left: 0; } .jss289 li { margin-left: 24px; margin-bottom: 8px; } .jss285:not(:last-child) { margin-bottom: 4px; } @media (min-width:960px) { .jss275 { margin-right: 20px; } } .jss276 { display: flex; align-items: center; border-bottom: 1px solid #c9c9c9; padding-bottom: 12px; } @media (min-width:960px) { .jss276 { padding-bottom: 8px; } } .jss276:not(:first-child) { padding-top: 12px; } @media (min-width:960px) { .jss276:not(:first-child) { padding-top: 8px; } } .jss277 { font-size: 0.875rem; font-weight: 700; margin-bottom: 4px; } @media (min-width:600px) { .jss277 { font-size: 0.75rem; padding-top: 2px; margin-bottom: 0; } } .jss278 { display: inline-block; font-size: 1rem; word-wrap: break-word; word-break: break-word; } @media (min-width:600px) { .jss278 { font-size: 0.875rem; padding-top: 2px; margin-bottom: 0; } } .jss279 { word-break: break-all; } .jss280 { color: #0f69af; font-size: 0.875rem; margin-top: 16px; font-weight: 900; } @media (min-width:960px) { .jss280 { font-size: 1rem; } } .jss281 { font-size: 0.75rem; transform: rotate(0deg); margin-top: 2px; transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 8px; } .jss282 { transform: rotate(180deg); } .jss283 { margin-top: 16px; } @media (min-width:960px) { .jss283 { margin-top: 20px; } } .jss284 { cursor: pointer; font-weight: 900; padding-left: 0.3125rem; } .jss274 { margin-bottom: 8px; } @media (min-width:600px) { .jss274 { margin-bottom: 16px; } } .jss180 { padding-top: 28px; padding-bottom: 120px; background-color: #f3f3f7; } @media (min-width:600px) { .jss180 { padding-top: 32px; } } .jss180 .pdpGrid__section { border-bottom: 1px solid #c9c9c9; } .jss180 .pdpGrid__section:nth-child(2n) { background-color: #ffffff; } .jss180 .productReviews { border-bottom: 1px solid #c9c9c9; background-color: #ffffff; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-section-summary .bv-section-summary-inline .bv-inline-histogram-ratings .bv-histogram-filter-helper { margin-left: 0!important; padding-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-flex-container-column { margin-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-section-summary-inline .bv-secondary-rating-summary .bv-table { margin-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-flex-container-column .bv-flex-container div:first-child { padding-left: 0!important; } @media (min-width:0px) and (max-width:599.95px) { .jss181 { padding-left: 0; padding-right: 0; } } .jss183 { background-color: #fff; } .jss184 { background-size: contain; background-image: url(/assets/images/supelco-organic-shape-1/supelco-organic-shape-1.png); background-repeat: no-repeat; background-position: 0% 101%; }
PHR1798
certified reference material
pharmaceutical secondary standard
traceable to BP 212
traceable to Ph. Eur. L0380000
traceable to USP 1359302
current certificate can be downloaded
pkg of 250 mg
HPLC: suitable
gas chromatography (GC): suitable
228-230 °C
pharmaceutical (small molecule)
neat
2-30°C
Cl.C1CN2C[C@@H](N=C2S1)c3ccccc3
1S/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/m1./s1
LAZPBGZRMVRFKY-HNCPQSOCSA-N
Looking for similar products? Visit Product Comparison Guide
Danger
Acute Tox. 3 Oral
6.1D - Non-combustible, acute toxic Cat.3 / toxic hazardous materials or hazardous materials causing chronic effects
WGK 3
Not applicable
Not applicable
Enter Lot Number to search for Certificate of Analysis (COA).
Enter Lot Number to search for Certificate of Origin (COO).
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
Contact Technical Service