a0"; position: absolute; transition: border-bottom-color 200ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; border-bottom: 1px solid rgba(0, 0, 0, 0.42); pointer-events: none; } .MuiInput-underline:hover:not(.Mui-disabled):before { border-bottom: 2px solid #000000; } .MuiInput-underline.Mui-disabled:before { border-bottom-style: dotted; } @media (hover: none) { .MuiInput-underline:hover:not(.Mui-disabled):before { border-bottom: 1px solid rgba(0, 0, 0, 0.42); } } .MuiPopover-paper { outline: 0; position: absolute; max-width: calc(100% - 32px); min-width: 16px; max-height: calc(100% - 32px); min-height: 16px; overflow-x: hidden; overflow-y: auto; } .MuiMenu-paper { max-height: calc(100% - 96px); -webkit-overflow-scrolling: touch; } .MuiMenu-list { outline: 0; } .MuiSelect-select { cursor: pointer; min-width: 16px; user-select: none; border-radius: 0; -moz-appearance: none; -webkit-appearance: none; } .MuiSelect-select:focus { border-radius: 0; background-color: rgba(0, 0, 0, 0.05); } .MuiSelect-select::-ms-expand { display: none; } .MuiSelect-select.Mui-disabled { cursor: default; } .MuiSelect-select[multiple] { height: auto; } .MuiSelect-select:not([multiple]) option, .MuiSelect-select:not([multiple]) optgroup { background-color: #fff; } .MuiSelect-select.MuiSelect-select { padding-right: 24px; } .MuiSelect-filled.MuiSelect-filled { padding-right: 32px; } .MuiSelect-outlined { border-radius: 5px; } .MuiSelect-outlined.MuiSelect-outlined { padding-right: 32px; } .MuiSelect-selectMenu { height: auto; overflow: hidden; min-height: 1.1876em; white-space: nowrap; text-overflow: ellipsis; } .MuiSelect-icon { top: calc(50% - 12px); color: rgba(0, 0, 0, 0.54); right: 0; position: absolute; pointer-events: none; } .MuiSelect-icon.Mui-disabled { color: #000000; } .MuiSelect-iconOpen { transform: rotate(180deg); } .MuiSelect-iconFilled { right: 7px; } .MuiSelect-iconOutlined { right: 7px; } .MuiSelect-nativeInput { left: 0; width: 100%; bottom: 0; opacity: 0; position: absolute; pointer-events: none; } .jss88 { border: none; font-size: 1rem; box-shadow: inset 0 0 0 1px #949494; box-sizing: border-box; min-height: 48px; transition: all .3s; line-height: 40px; border-radius: 5px; background-color: #fff; } @media (min-width:600px) { .jss88 { min-height: 40px; line-height: 32px; } } .jss88.jss88 { padding: 4px 32px 4px 12px; } .jss88:hover:not(.jss96) { box-shadow: inset 0 0 0 1px #0f69af; } .jss88:focus { box-shadow: inset 0 0 0 1px #0f69af, 0 0 6px 0 rgba(15, 105, 175, 0.5); border-radius: 5px; background-color: #fff; } .jss88.jss95 { box-shadow: inset 0 0 0 2px #ce0000; } .jss88.jss95:hover { box-shadow: inset 0 0 0 2px #ce0000; } .jss88.jss95:focus { box-shadow: inset 0 0 0 2px #ce0000; } .jss89 { border: 1px solid #f3f3f7; background-color: #f3f3f7; } .jss89:focus { background-color: #f3f3f7; } .jss90 { top: 21px; color: #0f69af; right: 16px; height: 6px; font-size: 0.625rem; } @media (min-width:600px) { .jss90 { top: 17px; } } @media (min-width:600px) { .jss91 { top: 13px; right: 12px; font-size: 0.5625rem; } } .jss92 { color: rgba(0, 0, 0, 0.38); } @media (min-width:600px) { .jss93 { font-size: 0.875rem; min-height: 32px; line-height: 23px; } .jss93.jss88 { padding: 4px 28px 4px 12px; } } .jss94 { font-size: 0.875rem; min-height: 48px; line-height: 38px; } @media (min-width:600px) { .jss94 { line-height: 40px; } } .jss94 ~ svg { top: 21px; } .jss96 { color: #000; border-color: #e4e4e4; background-color: #e4e4e4; } .jss98 .MuiMenuItem-root { white-space: break-spaces; } .jss99 { padding: 4px 0px; } .jss99 .MuiMenuItem-root { padding: 4px 12px; font-size: 0.875rem; } .jss100 { border: 1px solid #949494; margin-top: 4px; border-radius: 5px; } .jss135 { border: 1px solid #949494; margin-top: 4px; border-radius: 5px; } .MuiButton-root { color: #000000; padding: 6px 16px; font-size: 0.875rem; min-width: 144px; box-sizing: border-box; transition: background-color 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms,box-shadow 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms,border 250ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.75; padding-left: 24px; border-radius: 5px; padding-right: 24px; text-transform: none; } .MuiButton-root:hover { text-decoration: none; background-color: rgba(0, 0, 0, 0.04); } .MuiButton-root.Mui-disabled { color: #000000; } @media (hover: none) { .MuiButton-root:hover { background-color: transparent; } } .MuiButton-root:hover.Mui-disabled { background-color: transparent; } .MuiButton-label { width: 100%; display: inherit; align-items: inherit; justify-content: inherit; } .MuiButton-text { color: #0f69af; padding: 6px 8px; } .MuiButton-text:hover { color: #003f71; background-color: transparent; } .MuiButton-textPrimary { color: #0f69af; } .MuiButton-textPrimary:hover { background-color: transparent; } @media (hover: none) { .MuiButton-textPrimary:hover { background-color: transparent; } } .MuiButton-textSecondary { color: #503191; } .MuiButton-textSecondary:hover { color: #210953; background-color: transparent; } @media (hover: none) { .MuiButton-textSecondary:hover { background-color: transparent; } } .MuiButton-outlined { border: 1px solid rgba(0, 0, 0, 0.23); padding: 5px 15px; } .MuiButton-outlined.Mui-disabled { color: #949494; border: 1px solid #c9c9c9; border-color: #949494; } .MuiButton-outlinedPrimary { color: #0f69af; border: 1px solid rgba(15, 105, 175, 0.5); } .MuiButton-outlinedPrimary:hover { color: #003f71; border: 1px solid #0f69af; border-color: #003f71; background-color: transparent; } .MuiButton-outlinedPrimary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(15, 105, 175, 0.5), inset 0 0 0 1px #0f69af; border-color: #0f69af; } @media (hover: none) { .MuiButton-outlinedPrimary:hover { background-color: transparent; } } .MuiButton-outlinedSecondary { color: #503191; border: 1px solid rgba(80, 49, 145, 0.5); } .MuiButton-outlinedSecondary:hover { color: #210953; border: 1px solid #503191; border-color: #210953; background-color: transparent; } .MuiButton-outlinedSecondary.Mui-disabled { border: 1px solid #000000; } .MuiButton-outlinedSecondary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(80, 49, 145, 0.5), inset 0 0 0 1px #503191; border-color: #503191; } @media (hover: none) { .MuiButton-outlinedSecondary:hover { background-color: transparent; } } .MuiButton-contained { color: rgba(0, 0, 0, 0.87); box-shadow: none; background-color: #e4e4e4; } .MuiButton-contained:hover { color: #ffffff; box-shadow: none; background-color: #d5d5d5; } .MuiButton-contained.Mui-focusVisible { box-shadow: none; } .MuiButton-contained:active { box-shadow: none; } .MuiButton-contained.Mui-disabled { color: #ffffff; box-shadow: none; background-color: #949494; } @media (hover: none) { .MuiButton-contained:hover { box-shadow: 0px 1px 5px 0px rgba(0,0,0,0.0),0px 2px 2px 0px rgba(0,0,0,0.14),0px 3px 1px -2px rgba(0,0,0,0.12); background-color: #e4e4e4; } } .MuiButton-contained:hover.Mui-disabled { background-color: #c9c9c9; } .MuiButton-containedPrimary { color: #fff; background-color: #0f69af; } .MuiButton-containedPrimary:hover { background-color: #003f71; } .MuiButton-containedPrimary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(15, 105, 175, 0.5), inset 0 0 0 2px #ffffff; } @media (hover: none) { .MuiButton-containedPrimary:hover { background-color: #0f69af; } } .MuiButton-containedSecondary { color: #ffffff; background-color: #503191; } .MuiButton-containedSecondary:hover { background-color: #210953; } .MuiButton-containedSecondary.Mui-focusVisible { box-shadow: 0 0 6px 0 rgba(80, 49, 145, 0.5), inset 0 0 0 2px #ffffff; } @media (hover: none) { .MuiButton-containedSecondary:hover { background-color: #503191; } } .MuiButton-disableElevation { box-shadow: none; } .MuiButton-disableElevation:hover { box-shadow: none; } .MuiButton-disableElevation.Mui-focusVisible { box-shadow: none; } .MuiButton-disableElevation:active { box-shadow: none; } .MuiButton-disableElevation.Mui-disabled { box-shadow: none; } .MuiButton-colorInherit { color: inherit; border-color: currentColor; } .MuiButton-textSizeSmall { padding: 4px 5px; font-size: 0.8125rem; } .MuiButton-textSizeLarge { padding: 8px 11px; font-size: 0.9375rem; } .MuiButton-outlinedSizeSmall { padding: 3px 9px; font-size: 0.8125rem; } .MuiButton-outlinedSizeLarge { padding: 7px 21px; font-size: 0.9375rem; } .MuiButton-containedSizeSmall { padding: 4px 10px; font-size: 0.8125rem; } .MuiButton-containedSizeLarge { padding: 8px 22px; font-size: 0.9375rem; } .MuiButton-sizeLarge { padding: 10px 24px; font-size: 1rem; } @media (min-width:600px) { .MuiButton-sizeLarge { padding: 6px 24px; } } .MuiButton-sizeLarge.MuiButton-outlinedSizeLarge { padding: 9px 24px; } @media (min-width:600px) { .MuiButton-sizeLarge.MuiButton-outlinedSizeLarge { padding: 5px 24px; } } .MuiButton-fullWidth { width: 100%; } .MuiButton-startIcon { display: inherit; margin-left: -4px; margin-right: 8px; } .MuiButton-startIcon.MuiButton-iconSizeSmall { margin-left: -2px; } .MuiButton-endIcon { display: inherit; margin-left: 8px; margin-right: -4px; } .MuiButton-endIcon.MuiButton-iconSizeSmall { margin-right: -2px; } .MuiButton-iconSizeSmall > *:first-child { font-size: 18px; } .MuiButton-iconSizeMedium > *:first-child { font-size: 20px; } .MuiButton-iconSizeLarge > *:first-child { font-size: 22px; } .jss77 { border: none; height: 36px; display: flex; padding: 0px 16px; border-radius: 5px; } @media (min-width:960px) { .jss77 { border: 1px solid #949494; height: 40px; padding: 0; } } .jss78 { width: 100%; border: 1px solid #949494; padding-left: 12px; border-radius: 5px; } @media (min-width:960px) { .jss78 { border: none; } } .jss79 { order: 2; padding: 4px 0 7px; } .jss79::placeholder { color: #949494; opacity: 1; font-size: 0.875rem; } @media (min-width:960px) { .jss79::placeholder { color: unset; opacity: 0.75 !important; font-size: 0.875rem; } } .jss79:focus::placeholder { color: transparent; } .jss80 { color: #503191; order: 4; width: 32px; height: 70%; border-left: 1px solid #c9c9c9; flex-shrink: 0; margin-left: 12px; } @media (min-width:960px) { .jss80 { color: #fff; right: -1px; width: 56px; border: 1px solid #503191; height: 100%; font-size: 1.125rem; box-sizing: content-box; background-color: #503191; border-top-right-radius: 4px; border-bottom-right-radius: 4px; } } .jss81 { order: 1; height: 100%; display: flex; margin-right: 12px; } @media (min-width:960px) { .jss81 { display: none; } } .jss82 { display: none; } .jss83 { order: 4; display: inline-flex; margin-left: 12px; } .jss84 { order: 3; flex-shrink: 0; margin-left: 12px; } .jss85 { order: 3; height: 100%; display: none; font-size: 0.625rem; margin-left: 12px; } .jss86 { display: inline-flex; } .jss87 { display: none; } .jss87 .MuiSelect-root { height: 38px; padding: 4px 36px 4px 12px; position: relative; box-shadow: none; line-height: 30px; } .jss87 .MuiSvgIcon-root { top: 16px; } @media (min-width:960px) { .jss87 { display: block; } } .jss87 .MuiSelect-root:after { right: 0; width: 1px; bottom: 7px; height: 24px; content: ''; display: block; position: absolute; background: #949494; } .jss87 .MuiSelect-root:hover { box-shadow: none; } .jss87 .MuiSelect-root:focus-visible { outline: revert; } .MuiTypography-root { margin: 0; } .MuiTypography-body2 { color: #000000; font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.43; } .MuiTypography-body1 { color: #000000; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.5; } .MuiTypography-caption { color: #000000; font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 0.9375; } .MuiTypography-button { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.75; text-transform: uppercase; } .MuiTypography-h1 { color: #000000; font-size: 1.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 0.42px; } .MuiTypography-h2 { color: #000000; font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 1.5px; text-transform: uppercase; } .MuiTypography-h3 { color: #000000; font-size: 1.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; } .MuiTypography-h4 { color: #000000; font-size: 2.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.235; } .MuiTypography-h5 { font-size: 1.5rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.334; } .MuiTypography-h6 { font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.6; } .MuiTypography-subtitle1 { font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.75; } .MuiTypography-subtitle2 { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.57; } .MuiTypography-overline { font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 2.66; text-transform: uppercase; } .MuiTypography-srOnly { width: 1px; height: 1px; overflow: hidden; position: absolute; } .MuiTypography-alignLeft { text-align: left; } .MuiTypography-alignCenter { text-align: center; } .MuiTypography-alignRight { text-align: right; } .MuiTypography-alignJustify { text-align: justify; } .MuiTypography-noWrap { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .MuiTypography-gutterBottom { margin-bottom: 0.35em; } .MuiTypography-paragraph { margin-bottom: 16px; } .MuiTypography-colorInherit { color: inherit; } .MuiTypography-colorPrimary { color: #0f69af; } .MuiTypography-colorSecondary { color: #503191; } .MuiTypography-colorTextPrimary { color: #000000; } .MuiTypography-colorTextSecondary { color: rgba(0, 0, 0, 0.54); } .MuiTypography-colorError { color: #ce0000; } .MuiTypography-displayInline { display: inline; } .MuiTypography-displayBlock { display: block; } .MuiGrid-container { width: 100%; display: flex; flex-wrap: wrap; box-sizing: border-box; } .MuiGrid-item { margin: 0; box-sizing: border-box; } .MuiGrid-zeroMinWidth { min-width: 0; } .MuiGrid-direction-xs-column { flex-direction: column; } .MuiGrid-direction-xs-column-reverse { flex-direction: column-reverse; } .MuiGrid-direction-xs-row-reverse { flex-direction: row-reverse; } .MuiGrid-wrap-xs-nowrap { flex-wrap: nowrap; } .MuiGrid-wrap-xs-wrap-reverse { flex-wrap: wrap-reverse; } .MuiGrid-align-items-xs-center { align-items: center; } .MuiGrid-align-items-xs-flex-start { align-items: flex-start; } .MuiGrid-align-items-xs-flex-end { align-items: flex-end; } .MuiGrid-align-items-xs-baseline { align-items: baseline; } .MuiGrid-align-content-xs-center { align-content: center; } .MuiGrid-align-content-xs-flex-start { align-content: flex-start; } .MuiGrid-align-content-xs-flex-end { align-content: flex-end; } .MuiGrid-align-content-xs-space-between { align-content: space-between; } .MuiGrid-align-content-xs-space-around { align-content: space-around; } .MuiGrid-justify-content-xs-center { justify-content: center; } .MuiGrid-justify-content-xs-flex-end { justify-content: flex-end; } .MuiGrid-justify-content-xs-space-between { justify-content: space-between; } .MuiGrid-justify-content-xs-space-around { justify-content: space-around; } .MuiGrid-justify-content-xs-space-evenly { justify-content: space-evenly; } .MuiGrid-spacing-xs-1 { width: calc(100% + 4px); margin: -2px; } .MuiGrid-spacing-xs-1 > .MuiGrid-item { padding: 2px; } .MuiGrid-spacing-xs-2 { width: calc(100% + 8px); margin: -4px; } .MuiGrid-spacing-xs-2 > .MuiGrid-item { padding: 4px; } .MuiGrid-spacing-xs-3 { width: calc(100% + 12px); margin: -6px; } .MuiGrid-spacing-xs-3 > .MuiGrid-item { padding: 6px; } .MuiGrid-spacing-xs-4 { width: calc(100% + 16px); margin: -8px; } .MuiGrid-spacing-xs-4 > .MuiGrid-item { padding: 8px; } .MuiGrid-spacing-xs-5 { width: calc(100% + 20px); margin: -10px; } .MuiGrid-spacing-xs-5 > .MuiGrid-item { padding: 10px; } .MuiGrid-spacing-xs-6 { width: calc(100% + 24px); margin: -12px; } .MuiGrid-spacing-xs-6 > .MuiGrid-item { padding: 12px; } .MuiGrid-spacing-xs-7 { width: calc(100% + 28px); margin: -14px; } .MuiGrid-spacing-xs-7 > .MuiGrid-item { padding: 14px; } .MuiGrid-spacing-xs-8 { width: calc(100% + 32px); margin: -16px; } .MuiGrid-spacing-xs-8 > .MuiGrid-item { padding: 16px; } .MuiGrid-spacing-xs-9 { width: calc(100% + 36px); margin: -18px; } .MuiGrid-spacing-xs-9 > .MuiGrid-item { padding: 18px; } .MuiGrid-spacing-xs-10 { width: calc(100% + 40px); margin: -20px; } .MuiGrid-spacing-xs-10 > .MuiGrid-item { padding: 20px; } .MuiGrid-grid-xs-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-xs-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-xs-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-xs-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-xs-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-xs-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-xs-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-xs-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-xs-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-xs-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-xs-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-xs-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-xs-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-xs-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } @media (min-width:600px) { .MuiGrid-grid-sm-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-sm-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-sm-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-sm-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-sm-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-sm-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-sm-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-sm-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-sm-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-sm-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-sm-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-sm-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-sm-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-sm-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:960px) { .MuiGrid-grid-md-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-md-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-md-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-md-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-md-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-md-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-md-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-md-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-md-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-md-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-md-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-md-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-md-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-md-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:1280px) { .MuiGrid-grid-lg-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-lg-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-lg-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-lg-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-lg-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-lg-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-lg-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-lg-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-lg-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-lg-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-lg-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-lg-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-lg-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-lg-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } @media (min-width:1920px) { .MuiGrid-grid-xl-auto { flex-grow: 0; max-width: none; flex-basis: auto; } .MuiGrid-grid-xl-true { flex-grow: 1; max-width: 100%; flex-basis: 0; } .MuiGrid-grid-xl-1 { flex-grow: 0; max-width: 8.333333%; flex-basis: 8.333333%; } .MuiGrid-grid-xl-2 { flex-grow: 0; max-width: 16.666667%; flex-basis: 16.666667%; } .MuiGrid-grid-xl-3 { flex-grow: 0; max-width: 25%; flex-basis: 25%; } .MuiGrid-grid-xl-4 { flex-grow: 0; max-width: 33.333333%; flex-basis: 33.333333%; } .MuiGrid-grid-xl-5 { flex-grow: 0; max-width: 41.666667%; flex-basis: 41.666667%; } .MuiGrid-grid-xl-6 { flex-grow: 0; max-width: 50%; flex-basis: 50%; } .MuiGrid-grid-xl-7 { flex-grow: 0; max-width: 58.333333%; flex-basis: 58.333333%; } .MuiGrid-grid-xl-8 { flex-grow: 0; max-width: 66.666667%; flex-basis: 66.666667%; } .MuiGrid-grid-xl-9 { flex-grow: 0; max-width: 75%; flex-basis: 75%; } .MuiGrid-grid-xl-10 { flex-grow: 0; max-width: 83.333333%; flex-basis: 83.333333%; } .MuiGrid-grid-xl-11 { flex-grow: 0; max-width: 91.666667%; flex-basis: 91.666667%; } .MuiGrid-grid-xl-12 { flex-grow: 0; max-width: 100%; flex-basis: 100%; } } .MuiLink-underlineNone { text-decoration: none; } .MuiLink-underlineHover { text-decoration: none; } .MuiLink-underlineHover:hover { text-decoration: underline; } .MuiLink-underlineAlways { text-decoration: underline; } .MuiLink-button { border: 0; cursor: pointer; margin: 0; outline: 0; padding: 0; position: relative; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiLink-button::-moz-focus-inner { border-style: none; } .MuiLink-button.Mui-focusVisible { outline: auto; } .jss314 { color: #000000; border: 1px solid #949494; font-size: 1rem; transition: all .3s; border-radius: 5px; background-color: #fff; } .jss314:hover:not(.jss321):not(.jss322) { box-shadow: 0 0 6px 0 #0f69af; border-color: #0f69af; } .jss315 { height: 46px; padding: 4px 12px 6px; box-sizing: border-box; border-radius: 5px; } @media (min-width:600px) { .jss315 { height: 38px; } } .jss315[type=date]::-webkit-clear-button { display: none; } .jss315[type=date]::-webkit-inner-spin-button { display: none; } .jss315[type=date]::-webkit-calendar-picker-indicator { margin: 0; } .jss315[type=password] { padding: 8px 12px 6px; font-size: 16px; font-family: sans-serif; letter-spacing: 1px; } .jss315::placeholder { color: #949494; } .jss315::-ms-clear { display: none; } .jss316:not(.jss322) { box-shadow: 0 0 6px 0 #0f69af; border-color: #0f69af; } .jss317 { background-color: #fff; } .jss318 { height: 34px; } .jss319 { height: 46px; font-size: 0.875rem; } .jss320 { height: auto; } .jss321 { color: #000000; border-color: #c9c9c9; background-color: #c9c9c9; } .jss322 { border: solid 1px #ce0000; box-shadow: inset 0 0 0 1px #ce0000; } @media all and (-ms-high-contrast:none) { .jss314 .MuiInputAdornment-root { margin: 0; } } .MuiFormLabel-root { color: #000000; padding: 0; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1; } .MuiFormLabel-root.Mui-focused { color: #0f69af; } .MuiFormLabel-root.Mui-disabled { color: rgba(0, 0, 0, 0.38); } .MuiFormLabel-root.Mui-error { color: #ce0000; } .MuiFormLabel-colorSecondary.Mui-focused { color: #503191; } .MuiFormLabel-asterisk.Mui-error { color: #ce0000; } .jss307 { color: #000000; margin: 0px 0px 4px; display: block; font-size: 0.875rem; } .jss308 { font-size: 0.75rem; } .jss309 { margin: 0px 0px 12px 4px; font-size: 0.875rem; } .jss310 { color: #ce0000; font-weight: 900; } .jss255 { width: 100%; height: 100%; margin: auto; display: flex; outline: none; position: relative; background: #ffffff; overflow-y: auto; flex-direction: column; } @media (min-width:960px) { .jss255 { height: auto; margin-left: auto; margin-right: auto; border-radius: 6px; } } @media (min-width:960px) { .jss256 { width: 510px; max-height: 300px; } } @media (min-width:960px) { .jss257 { width: 620px; max-height: 400px; } } @media (min-width:960px) { .jss258 { width: 840px; max-height: 600px; } } .jss259 { width: 100%; display: flex; padding: 16px 16px 0px 16px; align-items: flex-start; justify-content: space-between; } @media (min-width:960px) { .jss259 { padding: 32px 32px 0px 32px; } } .jss260 { padding: 24px 16px 16px 16px; } @media (min-width:960px) { .jss260 { padding: 24px 32px 32px 32px; } } .jss261 { width: calc(100% - 16px); } .jss262 { font-size: 1rem; } .jss263 { font-size: 0.625rem; } .jss264 { color: rgba(0, 0, 0, 0.38); } .jss265 { display: flex; } .jss266 { top: 15px; right: 15px; position: absolute; } .jss267 { top: 16px; right: 16px; position: absolute; } @media (min-width:960px) { .jss267 { top: 32px; right: 32px; } } .jss268 { margin-top: 24px; justify-content: flex-end; } @media (min-width:960px) { .jss268 { display: flex; margin-top: 32px; } } .jss268 > * { width: 100%; } .jss268 > * + * { margin-top: 16px; } @media (min-width:960px) { .jss268 > * + * { margin-top: 0; margin-left: 16px; } } @media (min-width:960px) { .jss268 > * { width: auto; } } .MuiButtonBase-root { color: inherit; border: 0; cursor: pointer; margin: 0; display: inline-flex; outline: 0; padding: 0; position: relative; align-items: center; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; justify-content: center; text-decoration: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiButtonBase-root::-moz-focus-inner { border-style: none; } .MuiButtonBase-root.Mui-disabled { cursor: default; pointer-events: none; } @media print { .MuiButtonBase-root { color-adjust: exact; } } .jss171 { } @media (min-width:0px) { .jss171 { width: 0%; display: none; } } @media (min-width:600px) { .jss171 { width: 50%; display: flex; } } .MuiTypography-root { margin: 0; } .MuiTypography-body2 { color: #000000; font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.43; } .MuiTypography-body1 { color: #000000; font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.5; } .MuiTypography-caption { color: #000000; font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 0.9375; } .MuiTypography-button { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.75; text-transform: uppercase; } .MuiTypography-h1 { color: #000000; font-size: 1.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 0.42px; } .MuiTypography-h2 { color: #000000; font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; letter-spacing: 1.5px; text-transform: uppercase; } .MuiTypography-h3 { color: #000000; font-size: 1.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 900; line-height: 1.2; } .MuiTypography-h4 { color: #000000; font-size: 2.125rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.235; } .MuiTypography-h5 { font-size: 1.5rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.334; } .MuiTypography-h6 { font-size: 1.25rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.6; } .MuiTypography-subtitle1 { font-size: 1rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 1.75; } .MuiTypography-subtitle2 { font-size: 0.875rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; line-height: 1.57; } .MuiTypography-overline { font-size: 0.75rem; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 400; line-height: 2.66; text-transform: uppercase; } .MuiTypography-srOnly { width: 1px; height: 1px; overflow: hidden; position: absolute; } .MuiTypography-alignLeft { text-align: left; } .MuiTypography-alignCenter { text-align: center; } .MuiTypography-alignRight { text-align: right; } .MuiTypography-alignJustify { text-align: justify; } .MuiTypography-noWrap { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .MuiTypography-gutterBottom { margin-bottom: 0.35em; } .MuiTypography-paragraph { margin-bottom: 16px; } .MuiTypography-colorInherit { color: inherit; } .MuiTypography-colorPrimary { color: #0f69af; } .MuiTypography-colorSecondary { color: #503191; } .MuiTypography-colorTextPrimary { color: #000000; } .MuiTypography-colorTextSecondary { color: rgba(0, 0, 0, 0.54); } .MuiTypography-colorError { color: #ce0000; } .MuiTypography-displayInline { display: inline; } .MuiTypography-displayBlock { display: block; } .MuiLink-underlineNone { text-decoration: none; } .MuiLink-underlineHover { text-decoration: none; } .MuiLink-underlineHover:hover { text-decoration: underline; } .MuiLink-underlineAlways { text-decoration: underline; } .MuiLink-button { border: 0; cursor: pointer; margin: 0; outline: 0; padding: 0; position: relative; user-select: none; border-radius: 0; vertical-align: middle; -moz-appearance: none; background-color: transparent; -webkit-appearance: none; -webkit-tap-highlight-color: transparent; } .MuiLink-button::-moz-focus-inner { border-style: none; } .MuiLink-button.Mui-focusVisible { outline: auto; } .MuiCollapse-root { height: 0; overflow: hidden; transition: height 300ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; } .MuiCollapse-entered { height: auto; overflow: visible; } .MuiCollapse-hidden { visibility: hidden; } .MuiCollapse-wrapper { display: flex; } .MuiCollapse-wrapperInner { width: 100%; } .jss228 { display: flex; padding-top: 16px; justify-content: center; } .jss229 { justify-content: center; } .jss101 { width: 100%; z-index: 999; position: absolute; overflow-y: auto; padding-top: 12px; background-color: #fff; } @media (min-width:960px) { .jss101 { top: 44px; width: 100%; height: auto !important; box-shadow: 0px 6px 13px 0px rgba(0, 0, 0, 0.16); padding-top: 0; } } .jss102 { overflow: hidden; } .jss102 > * { border-top: 1px solid #e4e4e4; margin-top: -1px; } .jss103 { display: none; padding: 8px 16px 4px; align-items: center; } @media (min-width:600px) { .jss103 { display: flex; } } .jss104 { color: #fff; display: flex; padding: 2px 6px; font-size: 0.6875rem; font-weight: 900; border-radius: 3px; letter-spacing: 0.5px; text-transform: uppercase; background-color: #0f69af; } .jss105 { font-weight: 700; padding-left: 8px; } .jss106 { padding: 4px 0px 8px; } .jss106:empty { display: none; } .jss107 { margin: 8px 0px 2px 12px; font-size: 0.75rem; font-weight: 900; padding-left: 4px; border-bottom: 1px solid #e4e4e4; padding-bottom: 2px; } .jss108 { padding: 3px 20px; font-size: 0.875rem; } .jss109 { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .jss110 { width: 100%; display: flex; justify-content: space-between; } .jss110 > button { display: none; } .jss110.Mui-selected > button { display: none; } @media (min-width:960px) { .jss110.Mui-selected > button { display: block; } } @media (min-width:960px) { .jss110:hover > button { display: block; } } .jss111 { height: 500px; } .jss111 > button { display: block; } .jss112 { display: none; padding: 0; font-size: 0.75rem; } @media (min-width:960px) { .jss112 { display: flex; } } .jss113 { display: none; font-weight: 400; } @media (min-width:960px) { .jss113 { display: inline; } } .jss114 { margin-left: 4px; } .jss76 { width: 100%; position: relative; } .jss69 { display: block; } @media (max-width: 959px) { .jss69 { max-width: 100px; } } .MuiDrawer-docked { flex: 0 0 auto; } .MuiDrawer-paper { top: 0; flex: 1 0 auto; height: 100%; display: flex; outline: 0; z-index: 1200; position: fixed; overflow-y: auto; flex-direction: column; -webkit-overflow-scrolling: touch; } .MuiDrawer-paperAnchorLeft { left: 0; right: auto; } .MuiDrawer-paperAnchorRight { left: auto; right: 0; } .MuiDrawer-paperAnchorTop { top: 0; left: 0; right: 0; bottom: auto; height: auto; max-height: 100%; } .MuiDrawer-paperAnchorBottom { top: auto; left: 0; right: 0; bottom: 0; height: auto; max-height: 100%; } .MuiDrawer-paperAnchorDockedLeft { border-right: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedTop { border-bottom: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedRight { border-left: 1px solid rgba(0, 0, 0, 0.12); } .MuiDrawer-paperAnchorDockedBottom { border-top: 1px solid rgba(0, 0, 0, 0.12); } .jss115 { margin-bottom: 8px; } .jss116 { margin-bottom: 16px; } .jss117 { margin-bottom: 24px; } .jss118 { color: #000000; display: flex; padding: 0px 20px 0px 8px; font-size: 0.875rem; align-items: center; font-weight: 900; border-right: 2px solid rgba(0, 0, 0, 0.25); } .jss119 { padding: 0px 0px 0px 20px; font-size: 0.875rem; font-weight: 900; } .jss120 { color: #000000; width: 1rem; height: 1rem; margin-left: .2rem; margin-right: .5rem; } .jss121 { top: 1.9rem !important; z-index: 900 !important; } .jss122 { top: 1.2rem; color: #000; right: 4rem; position: absolute; } .jss123 { width: 1.6875rem; height: 1.6875rem; } .jss124 { font-size: 1.25rem; font-weight: 900; text-transform: uppercase; } .jss125 { font-size: 0.875rem; } .jss126 { z-index: 2500 !important; position: relative; min-width: 9.375rem; margin-top: 8px; } .jss127 { font-size: 0.875rem; min-height: 40px; padding-right: 20px; } .jss128 { cursor: pointer; padding: 8px 0px 8px 24px; font-size: 0.875rem; font-weight: 900; } .jss129 { width: 100%; display: flex; align-self: center; flex-direction: column; } .jss130 { width: 50%; height: inherit; max-width: 18.125rem; min-width: 8.75rem; margin-top: 12px; margin-bottom: 24px; } .jss131 { margin-left: 40px; } .jss132 { border: 1px solid #757575; height: 11.375rem; padding: 0; max-width: 18.125rem; overflow-y: scroll; border-radius: 3px; } .jss133 { overflow-y: hidden; } .jss134 { color: #fff; width: 9rem; height: 2.5rem; align-self: flex-end; background-color: #210953; } .jss136 { right: 0; } .jss137 { height: 100%; overflow: hidden; position: relative; } .jss138 { height: calc(100% - 80px); overflow-y: auto; } .jss139 { color: #000; padding: 0px 20px 20px; } .jss140 { width: 100%; display: flex; padding: 16px; align-items: center; border-bottom: 1px solid #503191; margin-bottom: 24px; justify-content: flex-end; } .jss140 > * + * { margin-left: auto; } .jss141 { color: #503191; font-size: 0.75rem; font-weight: 900; } .jss142 { color: #503191; font-size: 1.25rem; } .jss143 { color: #503191; font-size: 1.5rem; } .jss144 { border-bottom: 1px solid #503191; margin-bottom: 28px; padding-bottom: 12px; } .jss145 { color: #000; width: 100%; display: flex; font-size: 1.125rem; text-align: left; font-weight: 900; margin-bottom: 16px; justify-content: space-between; } .jss146 { font-size: 0.875rem; } .jss147 { color: #503191; font-size: 1.375rem; } .jss148 { color: #000; } .jss149 { color: #000; display: flex; font-size: 0.875rem; align-items: center; } .jss150 { font-size: 0.875rem; } .jss151 { color: #949494; font-size: 0.75rem; } .jss152 { min-width: 54px; } .jss153 { left: 16px; bottom: 16px; position: fixed; } .jss154 { margin-bottom: 4px; } .jss155 { margin-bottom: 16px; } .jss156 { margin-bottom: 24px; } .jss157 { height: 100%; } .jss157 > svg { font-size: 90px; } .jss14 { border-bottom: 1px solid #503191; padding-bottom: 12px; background-color: #fff; } @media (min-width:960px) { .jss14 { display: none; } } .jss15 { color: #503191; display: inline-flex; margin-left: auto; margin-right: 8px; } @media (min-width:960px) { .jss15 { display: none; } } .jss16 { display: none; } @media (min-width:960px) { .jss16 { display: flex; } } .jss17 { width: 100%; display: flex; padding: 0px 16px; position: relative; box-shadow: 0px 10px 10px -10px rgba(0,0,0,0.04); align-items: center; justify-content: space-between; } @media (min-width:960px) { .jss17 { padding: 16px 80px; } } .jss18 { display: flex; align-items: center; } .jss19 { display: none; } @media (min-width:960px) { .jss19 { color: #fff; width: 100%; height: 48px; display: flex; padding: 0px 80px; position: relative; background: #503191; box-shadow: 0 3px 8px 0 rgba(0, 0, 0, 0.16); align-items: center; } } .jss20 { height: 100%; display: flex; flex-grow: 1; align-items: center; justify-content: flex-end; } .jss21 { color: #fff; height: 1.125rem; flex-shrink: 0; font-weight: 900; border-right: 2px solid rgb(102 83 143); padding-left: 16px; padding-right: 16px; } .jss21:hover { color: #fff; } .jss22 { color: #fff; min-width: 7.3rem; font-weight: 900; padding-left: 20px; } .jss23 { color: #fff; height: 1.125rem; font-size: 0.875rem; font-weight: 900; padding-right: 16px; } .jss23:hover { color: #fff; } .jss23:not(:first-child) { padding-left: 16px; } .jss23:not(:last-child) { border-right: 2px solid rgb(102 83 143); } .jss24 { color: #fff; } .jss24:hover { color: #fff; } .jss25 { top: 0.0625rem; position: relative; font-size: 1.25rem; transform: rotate(0deg); transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 0.125rem; } .jss26 { transform: rotate(180deg); } .jss27 { cursor: pointer; display: flex; position: relative; font-size: 1.5rem; margin-right: 16px; } @media (min-width:960px) { .jss27 { display: none; } } .jss28 { top: 8.3rem !important; } .jss29 { height: calc(100vh - 56px); padding: 48px 64px 36px; background-color: #281949; } .jss29:focus { outline: none; } .jss30 { height: 100%; } .jss31 { top: 20px; right: 20px; position: absolute; } .jss32 { font-size: 28px; } .jss33 { margin-top: 12px; border-left: 1px solid #503191; } .jss33.MuiGrid-item { padding: 12px 28px; } .jss34 { height: 100%; overflow: auto; } .jss35 { font-size: 2.5rem; font-weight: 900; line-height: 1; } .jss36 { color: #fff; width: 100%; display: flex; font-size: 1rem; transition: color 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; align-items: center; font-weight: 400; margin-bottom: 24px; justify-content: space-between; } .jss36:hover { color: #9684BD; } .jss36 div { display: flex; } .jss37 { font-weight: 900; } .jss37:hover { color: #fff; } .jss38 { min-width: 196px; } .jss39 { font-size: 0.8125rem; min-height: 40px; } .jss40 { top: 4px; color: #8264c3; right: 4px; position: absolute; } .jss41 { padding: 0.5rem; border-radius: 5px; background-color: #0f69af; } .jss41:hover { background-color: #003f71; } .jss42 { color: #fff; } .jss43 { font-size: 1.1875rem; font-weight: 400; justify-content: flex-start; } .jss44 { padding: 0; flex-direction: row-reverse; } .jss45.expanded { transform: rotate(90deg); } .jss46 { display: flex; justify-content: center; } .jss47 { border-color: #e6e6ea; background-color: #e6e6ea; } .jss48 { height: inherit; padding-left: 16px; } .jss49 { height: 2.25rem; box-sizing: border-box; } .jss49::placeholder { opacity: 1 !important; font-size: 0.875rem; line-height: normal; } .jss49:focus::placeholder { color: transparent; } .jss50 { color: #000; width: 100%; border: 1px solid #616161; height: 2.375rem; display: flex; max-width: 700px; align-items: center; border-radius: 4px; justify-content: space-between; } .jss51 { top: 3.6rem; width: 50%; display: flex; padding: 16px 0px; z-index: 1200; position: absolute; max-width: 43.75rem; box-shadow: 0px 6px 13px 0px rgba(0, 0, 0, 0.16); overflow-y: auto; flex-direction: column; } @media (max-width:959.95px) { .jss51 { width: 30%; max-height: 540px; } } .jss52 { padding: 8px 8px 8px 16px; font-size: 0.75rem; font-weight: 900; } .jss53 { padding: 4px 8px 4px 32px; font-size: 0.875rem; } .jss53:hover { background-color: #e8f3fa; } .jss54 { color: #fff; width: 2.3rem; height: 100%; background-color: #210953; } .jss55 { height: 60%; } .jss56 { display: flex; font-size: 0.8125rem; align-items: center; flex-shrink: 0; font-weight: 900; line-height: 1; } .jss57 { cursor: pointer; } .jss58 { border: 1px solid #503191; display: flex; padding: 5px; font-size: 0.8125rem; min-width: 26px; align-items: center; margin-left: 12px; border-radius: 5px; justify-content: center; background-color: #503191; } .jss59 { color: #0f69af; padding: 4px 0px 4px 32px; font-size: 0.875rem; font-weight: 900; } .jss60 { flex-grow: 1; margin-right: 16px; } .jss61 { height: 48px; display: flex; font-size: 100px; } @media (min-width:960px) { .jss61 { font-size: 150px; } } .jss61 a { height: 48px; display: flex; } .jss62 { display: none; } @media (min-width:960px) { .jss62 { width: 100%; display: flex; margin-left: 20px; justify-content: center; } } @media (min-width:1280px) { .jss62 { margin: 0px 40px; } } .jss63 { display: none; } @media (min-width:960px) { .jss63 { display: flex; align-items: center; justify-content: flex-end; } } .jss64 { display: block; } @media (min-width:960px) { .jss64 { display: none; } } .jss70 { color: #fff; font-size: 0.875rem; margin-right: .5rem; } .jss71 { color: #503191; cursor: pointer; display: flex; padding: 0; font-size: 0.875rem; background: transparent; align-items: center; font-family: Noto Sans SC,Lato,-apple-system,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol"; font-weight: 700; border-color: transparent; } .jss71:focus { outline: none; } @media (min-width:960px) { .jss71 { color: #fff; } } .jss72 { display: flex; font-size: 24px; } @media (min-width:960px) { .jss72 { height: 19px; font-size: 22px; margin-right: 8px; } } .jss73 { display: none; } @media (min-width:960px) { .jss73 { display: inline; } } .jss74 { color: #503191; border: 1px solid #503191; height: 1.5rem; display: flex; font-size: 0.8125rem; min-width: 1.5rem; align-items: center; font-weight: 900; line-height: 1.5rem; margin-left: 8px; border-radius: 5px; justify-content: center; } @media (min-width:960px) { .jss74 { color: #000; font-size: 0.6875rem; margin-left: 12px; background-color: #fff; } } .jss75 { display: none; } @media (min-width:960px) { .jss75 { display: flex; } } .jss172:hover { color: #000000; background-color: #FFFFFF; } .jss172.jss177 { color: #000000; background-color: #FFFFFF; } .jss173 { display: inline-flex; padding: 0 16px; font-size: 0.875rem; align-items: center; font-weight: 900; line-height: 1; justify-content: center; } .jss174.jss177 { transform: rotate(180deg); } .jss158 { height: 100%; } .jss159 { color: #000; outline: none !important; padding: 15px 16px 30px; z-index: 2; background-color: #fff; } .jss159:before { top: -56px; left: 0; width: 100%; height: 56px; content: ""; position: absolute; box-shadow: 0 3px 8px 0 rgba(0, 0, 0, 0.16); pointer-events: none; } .jss159:after { top: 0; left: 0; width: 100%; height: 100%; content: ""; z-index: -1; position: absolute; box-shadow: 0 6px 12px 0 rgba(0, 0, 0, 0.16); } .jss159.jss162:before { display: none; } .jss160 { margin: 0 auto; outline: none !important; max-width: 1280px; } .jss161 { margin: -8px 0 -8px -20px; outline: none !important; min-width: 284px; } .jss164 { height: 100%; display: flex; padding: 8px 0; border-right: 2px solid rgba(201,201,201,0.25); flex-direction: column; } .jss164.jss163 { border-right: none; } .jss165 { color: #000000; width: 24px; height: 24px; margin: 0 14px 0 auto; padding: 0; min-width: 24px; } .jss166 { font-size: 24px; } .jss167 { width: 100%; padding: 8px 14px 8px 20px; font-size: 1rem; text-align: left; font-weight: 900; } .jss168 { margin: 0 14px 32px 20px; } .jss169 { width: 100%; display: block; margin-bottom: 8px; } .jss170 { font-size: 1rem; font-weight: 900; } .MuiContainer-root { width: 100%; display: block; box-sizing: border-box; margin-left: auto; margin-right: auto; padding-left: 16px; padding-right: 16px; } @media (min-width:600px) { .MuiContainer-root { padding-left: 40px; padding-right: 40px; } } .MuiContainer-disableGutters { padding-left: 0; padding-right: 0; } @media (min-width:600px) { .MuiContainer-fixed { max-width: 600px; } } @media (min-width:960px) { .MuiContainer-fixed { max-width: 960px; } } @media (min-width:1280px) { .MuiContainer-fixed { max-width: 1280px; } } @media (min-width:1920px) { .MuiContainer-fixed { max-width: 1920px; } } @media (min-width:0px) { .MuiContainer-maxWidthXs { max-width: 444px; } } @media (min-width:600px) { .MuiContainer-maxWidthSm { max-width: 600px; } } @media (min-width:960px) { .MuiContainer-maxWidthMd { max-width: 960px; } } @media (min-width:1280px) { .MuiContainer-maxWidthLg { max-width: 1280px; } } @media (min-width:1920px) { .MuiContainer-maxWidthXl { max-width: 1920px; } } .jss413 { color: #c9c9c9; padding: 0px 8px; } .jss414 { cursor: pointer; } .jss392 { width: 100%; padding: 20px 0px; background: #f3f3f7; } @media (min-width:960px) { .jss392 { padding: 40px 0px; } } .jss393 { margin: 0 auto; padding: 0px 20px; max-width: 1320px; } .jss394 { display: none; margin-bottom: 50px; } @media (min-width:960px) { .jss394 { display: flex; } } .jss395 { height: 200px; flex-grow: 1; border-right: 1px solid rgba(0, 0, 0, 0.26); } .jss396 { width: 100%; max-width: 200px; margin-right: 20px; } .jss396 h2 { margin: 0; font-size: 1rem; font-weight: 900; } .jss397 { display: block; font-size: 0.875rem; margin-top: 20px !important; font-weight: 900; line-height: 0.93; } .jss398 { margin: 7px -7px 8px -8px; display: flex; flex-wrap: wrap; } .jss399 { margin: 8px 8px 7px 7px; flex-shrink: 0; } .jss400 { width: 100%; max-width: 330px; margin-left: 68px; } .jss400 h2 { font-size: 16px; font-weight: 900; margin-bottom: 8px; } .jss401 { display: none; border-top: 2px solid rgba(0, 0, 0, 0.10); min-height: 80px; align-items: center; border-bottom: 2px solid rgba(0, 0, 0, 0.10); } @media (min-width:960px) { .jss401 { display: flex; } } .jss402 { max-width: 75px; max-height: 75px; flex-shrink: 0; } .jss403 { color: #000 !important; font-size: 1rem; font-weight: 900; line-height: 1.06; margin-left: 75px !important; } .jss404 { font-size: 0.75rem; margin-top: 0; } @media (min-width:960px) { .jss404 { margin-top: 32px; } } .jss404 p { margin: 0; } .jss405 { font-weight: 900; } .jss406 { display: block; } @media (min-width:960px) { .jss406 { display: flex; } } .jss407 { margin-right: 0; } @media (min-width:960px) { .jss407 { margin-right: 8px; } } .jss408 { margin-top: 2px; } @media (min-width:960px) { .jss408 { margin-top: 0; } } .jss409 { font-weight: 900; } .jss410 { color: #c9c9c9; padding: 0px 8px; } .jss411 { display: block; margin-bottom: 0; } .jss412 { display: block; margin-bottom: 0; } .jss328 { color: #0f69af; font-size: 0.875rem; font-weight: 900; } .jss328:hover, .jss328:focus-visible { color: #003f71; } .jss328:focus-visible { outline: revert; outline-offset: 2px; } .jss329 { font-size: 0.75rem; } .jss330 { font-size: 1rem; } .jss331 { font-size: 0; margin-right: 8px; } .jss4 { position: relative; } .jss5 { display: flex; padding: 8px 16px; align-items: flex-start; } @media (min-width:960px) { .jss5 { padding: 8px 32px; } } .jss6 { display: flex; align-items: baseline; } .jss7 { display: flex; align-items: baseline; } .jss7 > * + .jss6 { border-left: 1px solid #fff; margin-left: 16px; margin-right: 8px; padding-left: 16px; } .jss8 { color: #000; padding: 4px 0px 0px 8px; font-size: 0.875rem; margin-left: auto; } .jss9 { white-space: nowrap; } .jss9:disabled { opacity: 0.5; } .jss10 { color: #fff; background: #ce0000; border-bottom: 1px solid #eeeeee; } .jss10 a { color: #fff; text-decoration: underline; } .jss11 { background: #f7a703; border-bottom: 1px solid #eeeeee; } .jss12 { background: #fff; border-bottom: 1px solid #eeeeee; } .jss13 { color: #fff; background: #0f69af; border-bottom: 1px solid #eeeeee; } .jss13 .jss8 { color: #fff; } .jss13 .jss9 { color: #fff; } .jss13 .jss9:hover { color: #fff; text-decoration: underline; } .jss13 .jss9:focus { color: #fff; } .jss1 { height: 100%; display: flex; min-height: 1px; flex-direction: column; } .jss2 { flex: 1 0 auto; } .jss3 { flex-shrink: 0; } .jss387 { border-top: 1px solid #e4e4e4; padding-top: 8px; } .jss367 { color: #0f69af; cursor: pointer; } .jss358 { padding: 24px 16px; border-bottom: 1px solid #c9c9c9; } @media (min-width:960px) { .jss358 { padding: 32px 16px; } } .jss359 { font-size: 1rem; font-weight: 900; line-height: 1.25; margin-bottom: 8px; } @media (min-width:960px) { .jss359 { font-size: 1.5rem; margin-bottom: 8px; } .jss359 > a > span { font-weight: 700; } } @media (min-width:960px) { .jss360 { font-size: 1rem; } } @media (min-width:960px) { .jss361 { margin-bottom: 16px; } } @media (min-width:960px) { .jss362 { margin-bottom: 16px; } } .jss363 { padding-right: 8px; } .jss364 { font-size: 0.75rem; font-style: italic; margin-bottom: 16px; } @media (min-width:960px) { .jss365 { margin-bottom: 8px; } } .jss366 { margin: 0; } @media (min-width:960px) { .jss358 { padding: 0px 0px 8px 0px; border-bottom: none; } } .jss389 { color: #fff; right: 24px; width: 56px; bottom: 126px; height: 56px; display: flex; z-index: 2; position: fixed; box-shadow: 0 2px 4px rgba(0,0,0,.2); align-items: center; border-radius: 5px; flex-direction: column; text-transform: uppercase; justify-content: center; background-color: #0f69af; } .jss390 { font-size: 28px; margin-top: -5px; } .jss391 { font-size: 14px; margin-top: -6px; } .jss356 { margin-bottom: 0; } @media (min-width:960px) { .jss356 { margin-top: 16px; } } .jss357 { margin-bottom: 16px; } @media (min-width:960px) { .jss357 { margin-bottom: 8px; } } .jss269 { width: 100%; border: none; display: flex; padding: 32px 0px; background: none; text-align: left; align-items: center; justify-content: space-between; } @media (min-width:960px) { .jss269 { padding: 32px 0px 20px; } } .jss270:hover { cursor: pointer; } .jss271 { padding-bottom: 32px; } .jss272 { font-size: 12px; transition: transform 0.25s; } .jss273 { transform: rotate(180deg); } .jss355 > div > div { padding-top: 0; padding-left: 0; padding-bottom: 16px; } .jss350 { margin: 0; padding: 0; margin-bottom: 4px; list-style-type: none; margin-block-start: 0; padding-inline-start: 0; } .jss351 { padding: 16px 16px 32px; } @media (min-width:600px) { .jss351 { padding: 40px; } } .jss352 { color: #0f69af; display: flex; font-size: 1rem; align-items: center; font-weight: 900; } .jss353 { padding: 0; font-size: 1.125rem; transform: rotate(0deg); transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; } .jss354 { transform: rotate(180deg); } .jss230 { display: flex; flex-direction: column; } @media (min-width:960px) { .jss230 { padding-top: 16px; margin-bottom: 16px; } } .jss231 { height: 88px; } .jss232 { height: calc(100vh - 124px); display: flex; justify-content: center; } @media (min-width:960px) { .jss232 { height: 428px; } } .jss233 { width: 100%; height: 100%; display: flex; padding: 0px 48px; flex-direction: column; } @media (min-width:960px) { .jss233 { padding: 0px 64px; flex-direction: row; } } .jss234 { display: flex; padding: 16px 0px; align-items: center; flex-direction: column; justify-content: center; } @media (min-width:960px) { .jss234 { display: block; padding: 0; text-align: center; } } .jss235 { width: 100%; height: 92%; } @media (min-width:960px) { .jss235 { width: 50%; height: 100%; } } .jss236 { width: 100%; height: 100%; } .jss237 { border: solid 1px #c9c9c9; margin: 0 auto; max-width: 100%; max-height: 100%; touch-action: none; } @media (min-width:960px) { .jss237 { top: 50%; position: relative; transform: translateY(-50%); } } .jss238 { height: 8%; display: flex; align-items: center; justify-content: center; } @media (min-width:960px) { .jss238 { width: 50%; height: 428px; padding: 16px 0px 16px 24px; justify-content: flex-start; } } .jss239 { display: none; position: relative; max-height: 428px; padding-left: 12px; } .jss239:before { top: 2px; left: 0; width: 4px; height: 14px; content: ''; position: absolute; background-color: #503191; } @media (min-width:960px) { .jss239 { display: block; } } .jss240 { overflow: auto; max-height: 428px; word-break: break-word; } .jss241 { overflow: scroll; } .jss242 sup, .jss242 sub { top: -0.4em; position: relative; vertical-align: baseline; } .jss242 sub { top: 0.1em; } .jss243 { display: flex; justify-content: center; } @media (min-width:960px) { .jss243 { display: none; } } .jss244 { width: 2rem; border: 0; height: 4rem; box-shadow: 0px 3px 5px -1px rgba(0,0,0,0.0),0px 5px 8px 0px rgba(0,0,0,0.14),0px 1px 14px 0px rgba(0,0,0,0.12); background-color: #fff; } .jss245 { border-radius: 0 5px 5px 0; } .jss246 { border-radius: 5px 0 0 5px; } .jss247 { font-size: 2.125rem; } .jss248 { display: flex; align-items: center; } .jss249 { width: 54px; height: 54px; margin: 0 auto; display: block; position: relative; border-radius: 2px; } .jss250 { border: solid 2px #0f69af; } .jss251 { max-width: 100%; max-height: 100%; } .jss252 { top: 0; left: 0; right: 0; bottom: 0; position: absolute; background-color: rgba(0, 0, 0, .3); } .jss253 { margin: 0 auto; max-width: 350px; } .jss209 { margin-right: 8px; margin-bottom: 8px; } .jss209 sup { font-size: 75%; vertical-align: top; } .jss210 { width: auto; height: auto; max-width: 100%; max-height: 100%; margin-left: 8px; } .jss211 { width: 100%; height: 100%; display: flex; } .jss212 { display: flex; margin-bottom: 8px; flex-direction: row; } .jss213 { font-weight: 900; } .jss214 { color: #949494; font-weight: 900; margin-left: 8px; } .jss215 { display: flex; align-items: center; margin-bottom: 8px; } .jss216 { display: flex; flex-wrap: wrap; } .jss217 { font-size: 0.875rem; font-weight: 400; margin-left: 8px; } .jss219 { font-weight: 700; margin-bottom: 4px; } .jss220 { font-size: 0.75rem; } .jss221 { font-weight: 700; margin-bottom: 4px; } .jss222 { font-size: 0.75rem; } .jss223 { align-items: center; margin-bottom: 24px; } .jss224 { font-weight: 700; margin-bottom: 4px; } .jss225 { font-size: 0.625rem; margin-left: 8px; } .jss226 { font-size: 0.875rem; font-weight: 900; } @media (min-width:600px) { .jss223 { margin-bottom: 8px; } .jss224 { margin-bottom: 0; } } .jss192 { margin-bottom: 24px; } @media (min-width:600px) { .jss193 { margin-bottom: 24px; } } .jss194 { margin-bottom: 24px; } @media (min-width:600px) { .jss194 { margin-bottom: 8px; } } .jss195 { order: 2; } @media (min-width:600px) { .jss195 { order: 1; } } .jss196 { order: 1; } @media (min-width:600px) { .jss196 { order: 2; } } @media (min-width:600px) { .jss197 { display: none; } } @media (max-width:599.95px) { .jss198 { display: none; } } @media (min-width:600px) { .jss199 { margin-bottom: 32px; } } .jss200 { width: 100%; height: 100%; display: block; } .jss201 { width: 288px; margin: 0 auto; } @media (min-width:600px) and (max-width:959.95px) { .jss201 { width: 100px; } } @media (min-width:960px) and (max-width:1279.95px) { .jss201 { width: 135px; } } @media (min-width:1280px) { .jss201 { width: 180px; } } .jss202 { color: #0f69af; font-weight: 900; text-decoration: none; } .jss202:hover { cursor: pointer; } .jss203 { width: 288px; border: solid 1px #c9c9c9; height: 288px; margin: 0 auto; display: flex; border-radius: 5px; margin-bottom: 12px; justify-content: center; background-color: #fff; } @media (min-width:600px) and (max-width:959.95px) { .jss203 { width: 100px; height: 100px; } } @media (min-width:960px) and (max-width:1279.95px) { .jss203 { width: 135px; height: 135px; } } @media (min-width:1280px) { .jss203 { width: 170px; height: 170px; } } .jss204 { width: auto; height: auto; max-width: 100%; max-height: 100%; } .jss205 { padding-left: 0.25rem; } .jss206 { padding: 0px 16px; } @media (min-width:600px) { .jss206 { padding: 0; } } .jss207 { border-bottom: 1px solid #c9c9c9; margin-bottom: 24px; } @media (min-width:600px) { .jss207 { border: none; margin: 0; } } .jss388 { margin-bottom: 32px; } .jss290 { margin-bottom: 4px; } .jss291 { font-weight: 900; } .jss292 { padding-top: 6px; margin-bottom: 4px; } .jss292 img { max-width: 32px; margin-right: 10px; } .jss293 { word-break: break-word; } .jss311 { position: relative; } .jss312 { left: 0; right: 0; z-index: 1; position: absolute; margin-top: 8px; max-height: 268px; overflow-y: auto; } .jss313 { font-size: 0.875rem; padding-left: 12px; padding-right: 12px; } .jss332 { cursor: pointer; font-size: 1rem; } .jss333 { flex: 1; padding: 16px; overflow-y: scroll; } @media (min-width:960px) { .jss333 { padding: 32px 32px 48px; } } .jss334 { margin: 0px 0px 24px; padding-left: 20px; } .jss334 li:not(:last-child) { margin-bottom: 8px; } .jss335 { margin-bottom: 8px; } .jss336 { margin-bottom: 16px; } .jss337 { margin-bottom: 24px; } .jss323 { flex: 1; padding: 16px; overflow-y: scroll; } @media (min-width:960px) { .jss323 { padding: 32px 32px 48px; } } .jss324 { margin: 0px 0px 24px; padding-left: 20px; } .jss324 li:not(:last-child) { margin-bottom: 8px; } .jss325 { margin-bottom: 8px; } .jss326 { margin-bottom: 16px; } .jss327 { margin-bottom: 24px; } .jss297 { display: block; margin-bottom: 4px; } @media (min-width:600px) { .jss297 { display: flex; align-items: center; } } .jss298 { margin-top: 4px; } @media (min-width:600px) { .jss298 { margin-top: 0; border-left: solid 1px #c9c9c9; margin-left: 16px; padding-left: 16px; } } .jss299 { width: 100%; } @media (min-width:600px) { .jss299 { width: auto; } } .jss300 { color: #0f69af; font-size: 1rem; font-weight: 900; text-decoration: none; } .jss300:hover { cursor: pointer; } .jss301 { height: 150px; padding: 16px; } @media (min-width:960px) { .jss301 { padding: 32px; } } .jss302 { top: 4px; left: 8px; cursor: pointer; position: relative; } .jss303 { opacity: 0.64; } .jss304 { margin-bottom: 8px; } .jss305 { margin-bottom: 16px; } .jss306 { font-size: 0.875rem; margin-bottom: 24px; } .jss338 { margin-bottom: 5px; text-transform: capitalize; } .jss339 { font-size: 1rem; } .jss339:.MuiGrid-item { padding-top: 0; padding-bottom: 0; } .jss339 .MuiGrid-item { padding-top: 0; padding-bottom: 0; } .jss340 { color: #0f69af; font-size: 0.875rem; margin-top: 16px; font-weight: 900; } @media (min-width:960px) { .jss340 { font-size: 1rem; } } .jss340:last-of-type { padding-bottom: 0; } .jss341 { font-size: 0.625rem; transform: rotate(0deg); margin-top: 2px; transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 4px; } .jss342 { transform: rotate(180deg); } .jss343 { padding-bottom: 12px; } .jss294 { margin-bottom: 16px; text-transform: capitalize; } @media (min-width:960px) { .jss295 { padding-right: 32px; } } .jss296 { font-size: 1rem; } .jss185 { display: flex; padding: 16px 20px; margin-bottom: 32px; background-color: #e8f3fa; } @media (min-width:960px) { .jss185 { padding: 8px; align-items: center; justify-content: center; } } .jss186 { display: flex; margin-top: 4px; } @media (min-width:960px) { .jss186 { margin-top: 0; } } .jss187 { display: block; } @media (min-width:960px) { .jss187 { display: flex; align-items: center; } } .jss188 { font-size: 1rem; margin-right: 12px; } @media (min-width:960px) { .jss188 { margin-right: 12px; } } .jss189 { font-weight: 900; } @media (min-width:960px) { .jss190 { padding: 0px 12px; } } .jss191 { display: block; font-size: 0.875rem; margin-top: 4px; } @media (min-width:960px) { .jss191 { margin-top: 0; } } .jss344 { margin-bottom: 8px; } .jss345 { margin-bottom: 16px; } .jss346 { margin-bottom: 24px; } .jss347 { margin-bottom: 32px; } .jss348 { width: 100%; } @media (min-width:600px) { .jss348 { width: auto; } } .jss349 { padding: 12px 0px; } .jss368 { padding: 16px 16px 32px; } @media (min-width:600px) { .jss368 { padding: 40px; } } .jss369 { width: 100%; } .jss370 { height: 2.8125rem; display: flex; align-items: center; } .jss370 > * { overflow: hidden; white-space: nowrap; text-overflow: ellipsis; } .jss370 > *:nth-child(1) { width: 12%; } .jss370 > *:nth-child(2) { width: 14%; flex-shrink: 0; } .jss370 > *:nth-child(3) { width: 38%; flex-shrink: 0; } .jss370 > *:nth-child(4) { width: 13%; flex-shrink: 0; } .jss370 > *:nth-child(5) { width: 13%; flex-shrink: 0; } .jss370 > *:nth-child(6) { width: 6.25rem; text-align: center; flex-shrink: 0; padding-right: 0 !important; } .jss370 > *:not(:last-child) { padding-right: 12px; } .jss371 { font-size: 0.6875rem; font-weight: 400; padding-top: 16px; } .jss372 { padding-bottom: 16px; } .jss373 { padding: 0px 16px; margin-top: 16px; } .jss374 { min-width: 136px; } .jss375 { width: 550px; border: 4px solid grey; height: auto; z-index: 1; position: relative; min-height: auto; } .jss376 { width: 100%; height: 50px; display: flex; padding: 5px 10px; align-items: center; font-weight: 700; flex-direction: row; background-color: rgba(0,0,0,0.04); } .jss377 { color: #616161; right: 0.625rem; cursor: pointer; position: absolute; } .jss378 { width: 100%; height: 55%; margin: auto; padding: 10px 8px; font-size: 0.75rem; } .jss379 { margin: 0; padding: 0; list-style: none; } .jss379 li { position: relative; } .jss380 { opacity: 0.6; text-decoration: line-through; } .jss381 { display: flex; padding: 12px; font-size: 0.75rem; background-color: #f8f8f8; } .jss381 > * { display: flex; align-items: center; padding-right: 8px; } .jss381 > * > * { overflow: hidden; max-width: 100%; white-space: nowrap; text-overflow: ellipsis; } .jss381 > *:nth-child(1) { width: 12%; } .jss381 > *:nth-child(2) { width: 14%; } .jss381 > *:nth-child(3) { width: 35%; flex-grow: 1; flex-shrink: 2; } .jss381 > *:nth-child(4) { flex: 0 0 auto; width: 5%; justify-content: center; } .jss381 > *:nth-child(5) { width: 16.25rem; justify-content: flex-end; } .jss382 { flex: 1 1 auto; display: flex; align-items: center; justify-content: flex-end; } .jss383 { margin: 0; padding: 0px 8px; min-width: 0; background: none !important; } .jss383 * { color: #503191; } .jss384 { display: -webkit-box; overflow: hidden; white-space: inherit; -webkit-box-orient: vertical; -webkit-line-clamp: 2; } .jss385 { flex: 1 1 auto; color: #ce0000; font-size: 0.6875rem; text-align: right; font-weight: 400; } .jss386 > * { word-break: break-word; white-space: normal; } .jss286 { margin-bottom: 16px; } @media (min-width:1280px) { .jss287 { margin-right: 410px; } } .jss288:not(:last-child) { margin-bottom: 24px; } .jss289 { word-break: break-word; } .jss289:not(:last-child) { margin-bottom: 8px; } .jss289 *:not(a) { cursor: default; pointer-events: none; } .jss289 a { pointer-events: initial; } .jss289 ul { margin-left: 0; padding-left: 0; } .jss289 li { margin-left: 24px; margin-bottom: 8px; } .jss285:not(:last-child) { margin-bottom: 4px; } @media (min-width:960px) { .jss275 { margin-right: 20px; } } .jss276 { display: flex; align-items: center; border-bottom: 1px solid #c9c9c9; padding-bottom: 12px; } @media (min-width:960px) { .jss276 { padding-bottom: 8px; } } .jss276:not(:first-child) { padding-top: 12px; } @media (min-width:960px) { .jss276:not(:first-child) { padding-top: 8px; } } .jss277 { font-size: 0.875rem; font-weight: 700; margin-bottom: 4px; } @media (min-width:600px) { .jss277 { font-size: 0.75rem; padding-top: 2px; margin-bottom: 0; } } .jss278 { display: inline-block; font-size: 1rem; word-wrap: break-word; word-break: break-word; } @media (min-width:600px) { .jss278 { font-size: 0.875rem; padding-top: 2px; margin-bottom: 0; } } .jss279 { word-break: break-all; } .jss280 { color: #0f69af; font-size: 0.875rem; margin-top: 16px; font-weight: 900; } @media (min-width:960px) { .jss280 { font-size: 1rem; } } .jss281 { font-size: 0.75rem; transform: rotate(0deg); margin-top: 2px; transition: transform 150ms cubic-bezier(0.4, 0, 0.2, 1) 0ms; margin-left: 8px; } .jss282 { transform: rotate(180deg); } .jss283 { margin-top: 16px; } @media (min-width:960px) { .jss283 { margin-top: 20px; } } .jss284 { cursor: pointer; font-weight: 900; padding-left: 0.3125rem; } .jss274 { margin-bottom: 8px; } @media (min-width:600px) { .jss274 { margin-bottom: 16px; } } .jss180 { padding-top: 28px; padding-bottom: 120px; background-color: #f3f3f7; } @media (min-width:600px) { .jss180 { padding-top: 32px; } } .jss180 .pdpGrid__section { border-bottom: 1px solid #c9c9c9; } .jss180 .pdpGrid__section:nth-child(2n) { background-color: #ffffff; } .jss180 .productReviews { border-bottom: 1px solid #c9c9c9; background-color: #ffffff; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-section-summary .bv-section-summary-inline .bv-inline-histogram-ratings .bv-histogram-filter-helper { margin-left: 0!important; padding-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-flex-container-column { margin-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-section-summary-inline .bv-secondary-rating-summary .bv-table { margin-left: 0!important; } .jss180 .productReviews .bv-cv2-cleanslate .bv-core-container-99 .bv-flex-container-column .bv-flex-container div:first-child { padding-left: 0!important; } @media (min-width:0px) and (max-width:599.95px) { .jss181 { padding-left: 0; padding-right: 0; } } .jss183 { background-color: #fff; } .jss184 { background-size: contain; background-image: url(/assets/images/supelco-organic-shape-1/supelco-organic-shape-1.png); background-repeat: no-repeat; background-position: 0% 101%; }
All Photos(1)

PHR1798

Levamisole Hydrochloride

Pharmaceutical Secondary Standard; Certified Reference Material

Synonym(s):
(S)-(−)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole hydrochloride, (−)-Tetramisole hydrochloride, L(−)-2,3,5,6-Tetrahydro-6-phenylimidazo[2,1-b]thiazole hydrochloride, Levamisole hydrochloride
Empirical Formula (Hill Notation):
C11H12N2S · HCl
CAS Number:
Molecular Weight:
240.75
Beilstein:
4358988
EC Number:
MDL number:
NACRES:
NA.24

Quality Level

grade

certified reference material
pharmaceutical secondary standard

Agency

traceable to BP 212
traceable to Ph. Eur. L0380000
traceable to USP 1359302

CofA

current certificate can be downloaded

packaging

pkg of 250 mg

technique(s)

HPLC: suitable
gas chromatography (GC): suitable

mp

228-230 °C

application(s)

pharmaceutical (small molecule)

format

neat

storage temp.

2-30°C

SMILES string

Cl.C1CN2C[C@@H](N=C2S1)c3ccccc3

InChI

1S/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/m1./s1

InChI key

LAZPBGZRMVRFKY-HNCPQSOCSA-N

Looking for similar products? Visit Product Comparison Guide

General description

Pharmaceutical secondary standards for application in quality control provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards

Application

These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements.
Levamisole Hydrochloride may be used as a pharmaceutical reference standard for the determination of the analyte in pharmaceutical formulations by potentiometric sensing, spectrometric and atomic absorption spectroscopy methods.

Biochem/physiol Actions

Shows both immunostimulant and immunosuppressant effects, depending on several controllable factors. Very effective in treatment of ascariasis (hookworm infestation). Useful in chemotherapy of colorectal cancers, possibly due to its stimulation of IL-1 production and direct activation of macrophages.

Analysis Note

These secondary standards offer multi-traceability to the USP, EP and BP primary standards, where they are available.

Other Notes

This Certified Reference Material (CRM) is produced and certified in accordance with ISO 17034 and ISO/IEC 17025. All information regarding the use of this CRM can be found on the certificate of analysis.

Footnote

To see an example of a Certificate of Analysis for this material enter LRAC3172 in the Documents slot below. This is an example certificate only and may not be the lot that you receive.

Pictograms

Signal Word

Danger

Hazard Statements

Precautionary Statements

Hazard Classifications

Acute Tox. 3 Oral

Storage Class Code

6.1D - Non-combustible, acute toxic Cat.3 / toxic hazardous materials or hazardous materials causing chronic effects

WGK

WGK 3

Flash Point(F)

Not applicable

Flash Point(C)

Not applicable

Certificate of Analysis

Enter Lot Number to search for Certificate of Analysis (COA).

Certificate of Origin

Enter Lot Number to search for Certificate of Origin (COO).

More Documents

Quotes and Ordering

Indirect determination of levamisole by AAS and precipitation in a continuous-flow assembly
Ortiz SL, et al.
Microchemical Journal, Devoted to the Application of Microtechniques in All Branches of Science, 48(1), 112-117 (1993)
Potentiometric sensing of levamisole hydrochloride based on molecularly imprinted polymer
Sadeghi S, et al.
Sensors and Actuators B, Chemical, 122(1), 158-164 (2007)
Davide Caprini et al.
Advanced biology, 5(9), e2100927-e2100927 (2021-08-24)
AWC olfactory neurons are fundamental for chemotaxis toward volatile attractants in Caenorhabditis elegans. Here, it is shown that AWCON responds not only to chemicals but also to mechanical stimuli caused by fluid flow changes in a microfluidic device. The dynamics
Sreeparna Pradhan et al.
Current biology : CB, 29(17), 2867-2879 (2019-08-20)
Foraging strategies should be tuned to the expected distribution of resources in the environment. Tuning can occur over generations and lead to genetic differences in innate foraging behavior or over shorter timescales within an individual's lifespan. Both genetically encoded and
Jote T Bulcha et al.
Cell reports, 26(2), 460-468 (2019-01-10)
Biological systems must possess mechanisms that prevent inappropriate responses to spurious environmental inputs. Caenorhabditis elegans has two breakdown pathways for the short-chain fatty acid propionate: a canonical, vitamin B12-dependent pathway and a propionate shunt that is used when vitamin B12

Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.

Contact Technical Service